Fluoroaspirin

{{Chembox

| Name = Fluoroaspirin{{cite book |last1=Saunders |first1=BC |title=Some aspects of the chemistry and toxic action of organic compounds containing phosphorus and fluorine |date=1957 |url=http://chemistry-chemists.com/chemister/Warning/Poisons/PF.pdf}}

| ImageFile = Fluoroaspirin.svg

| PIN = 2-[(Fluoroacetyl)oxy]benzoic acid

| OtherNames = Fluoroacetylsalicylic acid,
O-(Fluoroacetyl)salicylic acid

| Section1 = {{Chembox Identifiers

| CASNo = 364-71-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 55RH7BA96P

| ChemSpiderID = 61085

| PubChem = 67766

| DTXSID = DTXSID30957750

| SMILES = c1ccc(c(c1)C(=O)O)OC(=O)CF

| StdInChI = InChI=1S/C9H7FO4/c10-5-8(11)14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,12,13)

| StdInChIKey = ISJRKJAXVBVDDK-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=9|H=7|F=1|O=4

}}

| Section3 = {{Chembox Hazards

| LD50 = 15 mg/kg (mice, subcutaneous)

}}

}}

Fluoroaspirin is the fluoroacetate ester of salicylic acid. It is the fluoroacetate analog of aspirin. Like other fluoroacetate esters, fluoroaspirin is highly toxic.{{cite journal |last1=Saunders |first1=B. C. |last2=Stacey |first2=G. J. |title=358. Toxic fluorine compounds containing the C–F link. Part I. Methyl Fluoroacetate and Related Compounds |journal=J. Chem. Soc. |date=1948 |volume=70 |pages=1773–1779 |doi=10.1039/JR9480001773|pmid=18106001 }}