:(R)-3-Nitrobiphenyline

{{Short description|Drug}}

{{DISPLAYTITLE:(R)-3-Nitrobiphenyline}}

{{Drugbox

| verifiedrevid = 456494074

| IUPAC_name = (R)-2-[1-(3'-Nitrobiphenyl-2-yloxy)ethyl]-4,5-dihydro-1H-imidazole

| image = (R)-3-Nitrobiphenyline.svg

| width = 170

| drug_name = (R)-3-Nitrobiphenyline

| tradename =

| MedlinePlus = a682611

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 945618-95-1

| ATC_prefix =

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 242693

| PubChem = 16757089

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 23288036

| C=17 | H=17 | N=3 | O=3

| smiles = c2ccc([N](=O)=O)cc2-c1ccccc1OC(C)C3=NCCN3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H17N3O3/c1-12(17-18-9-10-19-17)23-16-8-3-2-7-15(16)13-5-4-6-14(11-13)20(21)22/h2-8,11-12H,9-10H2,1H3,(H,18,19)/t12-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NMSAVNXFCXMJJY-GFCCVEGCSA-N

| melting_point =

| melting_high =

}}{{Technical|date=March 2021}}

(R)-3-Nitrobiphenyline is a drug which acts as an Alpha-2 adrenergic receptor agonist, selective for the Alpha-2C adrenergic receptor subtype, as well as being a weak antagonist at the Alpha-2A adrenergic receptor and Alpha-2B adrenergic receptor subtypes. It has been used in scientific research to characterize the binding and functional properties of the Alpha-2C adrenergic receptor subtype.{{cite journal | vauthors = Crassous PA, Cardinaletti C, Carrieri A, Bruni B, Di Vaira M, Gentili F, Ghelfi F, Giannella M, Paris H, Piergentili A, Quaglia W, Schaak S, Vesprini C, Pigini M | display-authors = 6 | title = Alpha2-adrenoreceptors profile modulation. 3.1 (R)-(+)-m-nitrobiphenyline, a new efficient and alpha2C-subtype selective agonist | journal = Journal of Medicinal Chemistry | volume = 50 | issue = 16 | pages = 3964–3968 | date = August 2007 | pmid = 17630725 | doi = 10.1021/jm061487a }}{{cite journal | vauthors = Del Bello F, Mattioli L, Ghelfi F, Giannella M, Piergentili A, Quaglia W, Cardinaletti C, Perfumi M, Thomas RJ, Zanelli U, Marchioro C, Dal Cin M, Pigini M | display-authors = 6 | title = Fruitful adrenergic α(2C)-agonism/α(2A)-antagonism combination to prevent and contrast morphine tolerance and dependence | journal = Journal of Medicinal Chemistry | volume = 53 | issue = 21 | pages = 7825–7835 | date = November 2010 | pmid = 20925410 | doi = 10.1021/jm100977d }}

References

{{reflist}}

{{Adrenergic receptor modulators}}

{{DEFAULTSORT:Nitrobiphenyline, (R)-3-}}

Category:Alpha-2 adrenergic receptor agonists

Category:Biphenyls

Category:Imidazolines

Category:3-Nitrophenyl compounds

Category:Phenol ethers

{{Pharm-stub}}