:(S)-Ipsdienol

{{DISPLAYTITLE:(S)-Ipsdienol}}

{{Chembox

| Name = (S)-Ipsdienol

| ImageFile = S-Ipsdienol.svg

| ImageSize =

| ImageAlt =

| ImageFile1 = Ipsdienol-3D-spacefill.png

| ImageAlt1 = Ipsdienol molecule

| PIN = (4S)-2-Methyl-6-methylideneocta-2,7-dien-4-ol

| OtherNames = (S)-(+)-Ipsdienol, 2-Methyl-6-methylene-2,7-octadiene-4-ol, Ipsdienol

|Section1={{Chembox Identifiers

| CASNo = 35628-00-3

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 83332

| EC_number = 609-154-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I0CK35047X

| PubChem = 92301

| StdInChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5-6,10-11H,1,4,7H2,2-3H3/t10-/m1/s1

| StdInChIKey = NHMKYUHMPXBMFI-SNVBAGLBSA-N

| SMILES = CC(=C[C@H](CC(=C)C=C)O)C

}}

|Section2={{Chembox Properties

| C=10 | H=16 | O=1

| Appearance = Colorless

| Density =

| MeltingPtC =

| MeltingPt_notes =

| BoilingPtC =

| BoilingPt_notes =

| Solubility = }}

|Section3={{Chembox Hazards

| GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/92301#section=Safety-and-Hazards]

| GHSPictograms = {{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|400}}

| PPhrases = {{P-phrases|273|391|501}}

| MainHazards =

| FlashPtC = 87

| AutoignitionPtC =

}}

}}

(S)-Ipsdienol is a terpene alcohol. It is one of the major aggregation pheromones of the bark beetle. It was first identified from Ips confusus, in which it is believed to be a principle sex attractant.{{cite journal |last1=Silverstein |first1=Robert M. |last2=Rodin | first2 = J. Otto | last3 = Wood | first3 = David L. |title=Sex Attractants in Frass Produced by Male Ips confusus in Ponderosa Pine |journal=Science |date=October 1966|volume=154 |issue=3748 |pages=509–510 |doi=10.1126/science.154.3748.509| jstor = 1720044 | url = https://www.science.org/doi/abs/10.1126/science.154.3748.509 |bibcode=1966Sci...154..509S |s2cid=80674108 |url-access=subscription }}

It is suggested that the compound plays a role in interspecies communication between Ips latidens and Ips ini, facilitating reductions in competition for breeding material and/or mating interference.{{cite journal |last1=Miller |first1=Daniel R. |last2=Borden| first2= John H. | last3 = King | first3 = G. G. S. | last4 = Slessor | first4 = Keith N. | title = Ipsenol: an aggregation pheromone for Ips latidens (Leconte) (Coleoptera: Scolytidae) |journal=Journal of Chemical Ecology |date=1 August 1991 |volume=17 |issue=8 |pages=1517–1527 |doi=10.1007/BF00984685|pmid=24257877 |s2cid=22337300 }}