:1,1'-Diaminoferrocene
{{Chembox
| ImageFile = 1,1'-Diaminoferrocene.svg
| ImageSize = 110
| ImageAlt =
| IUPACName = 1,1'-Diaminoferrocene
| OtherNames =
| SystematicName = Ferrocene-1,1'-diamine
| Section1 = {{Chembox Identifiers
| CASNo = 41636-79-7
| ChemSpiderID = 57269733
| PubChem = 15912376
| StdInChI=1S/2C5H6N.Fe/c2*6-5-3-1-2-4-5;/h2*1-4H,6H2;/q2*-1;+2
| StdInChIKey = VEDYBWCXQCEXEB-UHFFFAOYSA-N
| SMILES = C1=C[C-](C=C1)N.C1=C[C-](C=C1)N.[Fe+2]
}}
| Section2 = {{Chembox Properties
| C = 10|H=12|N = 2|Fe=1
| MolarMass =
| Appearance = yellow solid
| MeltingPtC = 183-186
| BoilingPt =
| BoilingPt_notes = decomposition
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
1,1'-Diaminoferrocene is the organoiron compound with the formula {{chem2|Fe(C5H4NH2)2}}. It is the simplest diamine derivative of ferrocene. It is a yellow, air-sensitive solid that is soluble in aqueous acid. The 1,1' part of its name refers to the location of the amine groups on separate rings. Compared to the parent ferrocene, the diamine is about 600 mV more reducing.
It can be prepared from the diisocyanate 1,1'-Ferrocenediisocyanate, which in turn is derived from 1,1'-ferrocenedicarboxylic acid.{{cite journal |doi=10.1021/om4004972|title=Large-Scale Preparation of 1,1′-Ferrocenedicarboxylic Acid, a Key Compound for the Synthesis of 1,1′-Disubstituted Ferrocene Derivatives |year=2013 |last1=Petrov |first1=Alex R. |last2=Jess |first2=Kristof |last3=Freytag |first3=Matthias |last4=Jones |first4=Peter G. |last5=Tamm |first5=Matthias |journal=Organometallics |volume=32 |issue=20 |pages=5946–5954 }} 1,1'-Diaminoferrocene was originally prepared by hydrogenation of 1,1'-diazidoferrocene ( {{chem2|Fe(C5H4N3)2}}).{{cite journal |doi=10.1021/om0004085|title=Synthesis, Structure, and Properties of 1,1'-Diamino- and 1,1'-Diazidoferrocene |year=2000 |last1=Shafir |first1=Alexandr |last2=Power |first2=Maurice P. |last3=Whitener |first3=Glenn D. |last4=Arnold |first4=John |journal=Organometallics |volume=19 |issue=19 |pages=3978–3982 }}
1,1'-Diaminoferrocene has been incorporated into various diamide and diimine ligands, which form catalysts that exhibit redox switching.{{cite journal |doi=10.1021/ja505883u|title=Redox Control of Group 4 Metal Ring-Opening Polymerization Activity toward l-Lactide and ε-Caprolactone |year=2014 |last1=Wang |first1=Xinke |last2=Thevenon |first2=Arnaud |last3=Brosmer |first3=Jonathan L. |last4=Yu |first4=Insun |last5=Khan |first5=Saeed I. |last6=Mehrkhodavandi |first6=Parisa |last7=Diaconescu |first7=Paula L. |journal=Journal of the American Chemical Society |volume=136 |issue=32 |pages=11264–11267 |pmid=25062499 |bibcode=2014JAChS.13611264W |s2cid=22098566 |url=https://escholarship.org/uc/item/5hm8f76w |url-access=subscription }}