:1,1'-Ferrocenedicarboxylic acid
{{Chembox
| ImageFile = Fc(CO2H)2.svg
| ImageSize = 120
| ImageAlt =
| IUPACName = 1,1'-Ferrocenedicarboxylic acid
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 1293-87-4
| ChemSpiderID = 198591
| EINECS = 215-068-9
| PubChem = 16211180
| StdInChI=1S/2C6H5O2.Fe/c2*7-6(8)5-3-1-2-4-5;/h2*1-4H,(H,7,8);
| StdInChIKey = ISVVAJYTLASNEJ-UHFFFAOYSA-N
| SMILES = [CH]1[CH][CH][C]([CH]1)C(=O)O.[CH]1[CH][CH][C]([CH]1)C(=O)O.[Fe]
}}
|Section2={{Chembox Properties
| C = 12|H = 10|O = 4|Fe=1
| MolarMass =
| Appearance = yellow solid
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|315|319|335}}
| PPhrases = {{P-phrases|}}
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
|Section8 = {{Chembox Related
| OtherCompounds = Ferrocenecarboxylic acid
}}
}}
1,1'-Ferrocenedicarboxylic acid is the organoiron compound with the formula {{chem2|Fe(C5H4CO2H)2}}. It is the simplest dicarboxylic acid derivative of ferrocene. It is a yellow solid that is soluble in aqueous base. The 1,1' part of its name refers to the location of the carboxylic acid groups on separate rings.
It can be prepared by hydrolysis of its diesters {{chem2|Fe(C5H4CO2R)2}} (R = Me, Et), which in turn are obtained by treatment of ferrous chloride with the sodium salt of the carboxyester of cyclopentadienide {{chem2|(C5H4CO2R)-}}. Ferrocenedicarboxylic acid is the precursor to many derivatives such as the diacid chloride, the diisocyanate, the diamide, and diamine, respectively, {{chem2|Fe(C5H4COCl)2}}, 1,1'-Ferrocenediisocyanate, {{chem2|Fe(C5H4CONH2)2}}, and 1,1'-Diaminoferrocene.{{cite journal |doi=10.1021/om4004972|title=Large-Scale Preparation of 1,1′-Ferrocenedicarboxylic Acid, a Key Compound for the Synthesis of 1,1′-Disubstituted Ferrocene Derivatives |year=2013 |last1=Petrov |first1=Alex R. |last2=Jess |first2=Kristof |last3=Freytag |first3=Matthias |last4=Jones |first4=Peter G. |last5=Tamm |first5=Matthias |journal=Organometallics |volume=32 |issue=20 |pages=5946–5954 }}
Derivatives of ferrocenedicarboxylic acid are components of some redox switches and redox active coatings.{{cite journal |doi=10.1021/la011101t|title=Characterization of Indium−Tin Oxide Interfaces Using X-ray Photoelectron Spectroscopy and Redox Processes of a Chemisorbed Probe Molecule: Effect of Surface Pretreatment Conditions |year=2002 |last1=Donley |first1=Carrie |last2=Dunphy |first2=Darren |last3=Paine |first3=David |last4=Carter |first4=Chet |last5=Nebesny |first5=Ken |last6=Lee |first6=Paul |last7=Alloway |first7=Dana |last8=Armstrong |first8=Neal R. |journal=Langmuir |volume=18 |issue=2 |pages=450–457 }}{{cite book |doi=10.1021/bk-2006-0928.ch027|chapter=Peptide Films on Surfaces: Preparation and Electron Transfer |title=Metal-Containing and Metallosupramolecular Polymers and Materials |series=ACS Symposium Series |year=2006 |last1=Orlowski |first1=G. A. |last2=Kraatz |first2=H. B. |volume=928 |pages=392–400 |isbn=9780841239296 }}