:2,3-Dihydroxycinnamic acid

{{Chembox

| ImageFile = 2,3-Dihydroxycinnamic acid.svg

| ImageSize = 200px

| ImageAlt = Chemical structure of 2,3-dihydroxycinnamic acid

| PIN = (2E)-3-(2,3-Dihydroxyphenyl)prop-2-enoic acid

| OtherNames = trans-2,3-Dihydroxycinnamate
3-(2,3-Dihydroxyphenyl)acrylic acid

|Section1={{Chembox Identifiers

| CASNo = 31082-90-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8EU63XMR43

| PubChem = 5282146

| ChemSpiderID = 4445343

| SMILES = c1cc(c(c(c1)O)O)/C=C/C(=O)O

| InChI = 1/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+

| InChIKey = SIUKXCMDYPYCLH-SNAWJCMRBO

| StdInChI = 1S/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+

| StdInChIKey = SIUKXCMDYPYCLH-SNAWJCMRSA-N

}}

|Section2={{Chembox Properties

| C=9 | H=8 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

2,3-Dihydroxycinnamic acid is a hydroxycinnamic acid. It is an isomer of caffeic acid.

It is a metabolite found in human urine.{{Cite journal | pmid = 3158357 | year = 1985 | last1 = Heindl | first1 = A | last2 = Rau | first2 = O | last3 = Spiteller | first3 = G | title = Identification of aromatic dihydroxy acids in biological fluids | volume = 12 | issue = 2 | pages = 59–66 | journal = Biomedical Mass Spectrometry| doi = 10.1002/bms.1200120203 }}