:2-Iodobenzoic acid

{{chembox

| Watchedfields = changed

| verifiedrevid = 477213655

| Name = 2-Iodobenzoic acid

| Reference =

| ImageFile = 2-Iodobenzoic acid.svg

| ImageSize = 120px

| PIN = 2-Iodobenzoic acid

| OtherNames = o-Iodobenzoic acid

|Section1={{Chembox Identifiers

| CASNo = 88-67-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7Q00V80J7Q

| PubChem = 6941

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6675

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 287979

| SMILES = O=C(O)c1ccccc1I

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 112424

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey=CJNZAXGUTKBIHP-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula = C₇H₅IO₂

| MolarMass = 248.018 g/mol

| Appearance = white solid

| Density = 2.25 g/cm³

| MeltingPtC = 162

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

|Section7={{Chembox Hazards

| NFPA-H =

| NFPA-F =

| NFPA-R =

| ExternalSDS =

}}

| Section8 = {{Chembox Related

| OtherCompounds = 4-Iodobenzoic acid

}}

}}

2-Iodobenzoic acid, or o-iodobenzoic acid, is an isomer of iodobenzoic acid.{{Cite web |website=PubChem |title=2-Iodobenzoic acid |url=https://pubchem.ncbi.nlm.nih.gov/compound/6941 |access-date=2022-11-27 |language=en}} The synthesis of 2-iodobenzoic acid via the diazotization of anthranilic acid is commonly performed in university organic chemistry labs. One of its most common uses is as a precursor for the preparation of IBX and Dess–Martin periodinane, both used as mild oxidants.