:2-Methoxyestrone

{{Chembox

| ImageFile = 2-Methoxyestrone.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3-Hydroxy-2-methoxyestra-1,3,5(10)-trien-17-one

| SystematicName = (3aS,3bR,9bS,11aS)-7-Hydroxy-8-methoxy-11a-methyl-2,3,3a,3b,4,5,9b,10,11,11a-decahydro-1H-cyclopenta[a]phenanthren-1-one

| OtherNames = 2-ME1; 2-MeOE1; 2-MeO-E1; 2-Hydroxyestrone 2-methyl ether; 2-Methoxyestra-1,3,5(10)-trien-3-ol-17-one

| Section1 = {{Chembox Identifiers

| CASNo = 362-08-3

| ChEBI = 1189

| ChEMBL = 425194

| ChemSpiderID = 389515

| KEGG = C05299

| PubChem = 440624

| StdInChI = 1S/C19H24O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,20H,3-8H2,1-2H3/t12-,13+,15-,19-/m0/s1

| StdInChIKey = WHEUWNKSCXYKBU-QPWUGHHJSA-N

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=C(C=C34)OC)O

| UNII = SJ5857RRL3

}}

| Section2 = {{Chembox Properties

| C=19 | H=24 | O=3

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

2-Methoxyestrone (2-ME1) is an endogenous, naturally occurring methoxylated catechol estrogen and metabolite of estrone that is formed by catechol O-methyltransferase via the intermediate 2-hydroxyestrone.{{cite web | url=http://www.hmdb.ca/metabolites/hmdb00010 | title=Human Metabolome Database: Showing metabocard for 2-Methoxyestrone (HMDB0000010) }}{{cite book | first = Anna R. | last = Hemnes | name-list-style = vanc |title=Gender, Sex Hormones and Respiratory Disease: A Comprehensive Guide|url=https://books.google.com/books?id=4So3CwAAQBAJ&pg=PA32|date=16 December 2015|publisher=Humana Press|isbn=978-3-319-23998-9|pages=32–}}{{cite book | first1 = Christian | last1 = Lauritzen | first2 = John W. W. | last2 = Studd | name-list-style = vanc |title=Current Management of the Menopause|url=https://books.google.com/books?id=WD7S7677xUUC&pg=PA378|date=22 June 2005|publisher=CRC Press|isbn=978-0-203-48612-2|pages=378–379}} Unlike estrone but similarly to 2-hydroxyestrone and 2-methoxyestradiol, 2-methoxyestrone has very low affinity for the estrogen receptor and lacks significant estrogenic activity.{{cite journal | vauthors = Bhavnani BR, Nisker JA, Martin J, Aletebi F, Watson L, Milne JK | title = Comparison of pharmacokinetics of a conjugated equine estrogen preparation (premarin) and a synthetic mixture of estrogens (C.E.S.) in postmenopausal women | journal = Journal of the Society for Gynecologic Investigation | volume = 7 | issue = 3 | pages = 175–83 | year = 2000 | pmid = 10865186 | doi = 10.1016/s1071-5576(00)00049-6 }}

{{Selected biological properties of endogenous estrogens in rats}}