:2-Nonanol
{{chembox
| Verifiedfields = changed
| verifiedrevid = 477214998
| ImageFile=2-Nonanol.svg
| ImageSize=
| PIN=Nonan-2-ol
| OtherNames=
|Section1={{Chembox Identifiers
| InChIKey = NGDNVOAEIVQRFH-UHFFFAOYAZ
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 454517
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H20O/c1-3-4-5-6-7-8-9(2)10/h9-10H,3-8H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NGDNVOAEIVQRFH-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo=628-99-9
| PubChem=12367
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 78304
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 292T5234DX
| SMILES = OC(CCCCCCC)C
| InChI=1/C9H20O/c1-3-4-5-6-7-8-9(2)10/h9-10H,3-8H2,1-2H3
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 11861
}}
|Section2={{Chembox Properties
| Formula=C9H20O
| MolarMass=144.2545
| Appearance=
| Density= 0.827 g/mL
| MeltingPtC= −36 - −35
| BoilingPtC= 193-194
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
2-Nonanol is a simple alcohol. It has the odor of cucumber, and has been identified in oysters.{{cite journal | doi = 10.1002/jsfa.1236 | title = Identification and origin of the character-impact compounds of raw oyster Crassostrea gigas | year = 2002 | author = Pennarun, Anne-Laure | journal = Journal of the Science of Food and Agriculture | volume = 82 | pages = 1652 | last2 = Prost | first2 = Carole | last3 = Demaimay | first3 = Michel | issue = 14| bibcode = 2002JSFA...82.1652P }} It is used by several insects as pheromones.{{cite web | title = Nonan-2-ol: Behavioral Function | publisher = Pherobase | url = http://www.pherobase.com/database/compound/compounds-detail-nonan-2-ol.php}} It is commercially available.