:2C-O-4

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477216433

| ImageFile = 2C-O-4-Chemdraw.png

| ImageSize = 180px

| ImageFile2 = 2C-O-4 animation.gif

| ImageSize2 = 200px

| PIN = 2-{2,5-Dimethoxy-4-[(propan-2-yl)oxy]phenyl}ethan-1-amine

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106225

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H21NO3/c1-9(2)17-13-8-11(15-3)10(5-6-14)7-12(13)16-4/h7-9H,5-6,14H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KAKXJLWAEMHHTL-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 952006-65-4

| PubChem = 44719510

| UNII = 1GFL65O0VB

| SMILES = CC(C)Oc1cc(OC)c(cc1OC)CCN

}}

|Section2={{Chembox Properties

| Formula =

| C=13 | H=21 | N=1 | O=3

| MolarMass = 239.31 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

2C-O-4, also known as 4-isopropoxy-2,5-dimethoxyphenethylamine, is a phenethylamine of the 2C family. It is also a positional isomer of isoproscaline and was probably first synthesized by Alexander Shulgin. It produces hallucinogenic, psychedelic, and entheogenic effects.{{CitePiHKAL}} [http://www.erowid.org/library/books_online/pihkal/pihkal035.shtml 2C-O-4 Entry in PiHKAL] Because of the low potency of 2C-O-4, and the inactivity of 2C-O, Shulgin felt that the 2C-O series would not be an exciting area for research, and did not pursue any further analogues.