:3'-Hydroxyechinenone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid =

| Reference =

| Name = 3′-Hydroxyechinenone

| ImageFile = 3'-Hydroxyechinenone.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName = (3′R)-3′-Hydroxy-β,β-caroten-4-one

| SystematicName = 3-{(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-Hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonen-1-yl}-2,4,4-trimethylcyclohex-2-en-1-one

| OtherNames = LMPR01070098; 3'-OH-Echinenone; C15965

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo =

| PubChem = 16061233

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 80214

| KEGG = C15965

| ChemSpiderID = 17220910

| SMILES = CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(C(=O)CCC2(C)C)C)/C)/C

| StdInChI = 1S/C40H54O2/c1-29(17-13-19-31(3)21-23-36-33(5)27-35(41)28-40(36,9)10)15-11-12-16-30(2)18-14-20-32(4)22-24-37-34(6)38(42)25-26-39(37,7)8/h11-24,35,41H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-/m1/s1

| StdInChIKey = ZRCXVNZZDQGBQT-BANQPSJHSA-N

}}

|Section2={{Chembox Properties

| C=40|H=54|O=2

| Appearance =

| Density =

| MeltingPtC =

| MeltingPt_notes =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

3′-Hydroxyechinenone is a keto-carotenoid pigment found in cyanobacteria and microalgae. Carotenoids belong to a larger class of phytochemicals known as terpenoids. The chemical formula of canthaxanthin is C₄₀H₅₄O₂. It is found non-covalently bound in the orange carotenoid protein (OCP), which is a soluble protein involved in photoprotection and non-photochemical quenching of photosynthesis.