:3-Acetyl-6-methoxybenzaldehyde

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477217885

| Name = 3-Acetyl-6-methoxybenzaldehyde

| ImageFile = 3-Acetyl-6-methoxybenzaldehyde.svg

| ImageSize = 200px

| ImageName = Chemical structure of 3-acetyl-6-methoxybenzaldehyde

| ImageAlt = Chemical structure of 3-acetyl-6-methoxybenzaldehyde

| PIN = 5-Acetyl-2-methoxybenzaldehyde

| SystematicName = 5-Ethanoyl-2-methoxybenzenecarbaldehyde

| OtherNames =

|Section1= {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 531-99-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = PKZ321UNPK

| PubChem = 288758

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 254697

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H10O3/c1-7(12)8-3-4-10(13-2)9(5-8)6-11/h3-6H,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WGQVKYPDHREEJU-UHFFFAOYSA-N

| SMILES = CC(=O)C1=CC(=C(C=C1)OC)C=O

| InChI =

| MeSHName =

}}

|Section2= {{Chembox Properties

| C=10 | H=10 | O=3

| MolarMass = 178.18 g/mol

| Appearance =

| Density = 1.137 g/mL

| MeltingPt =

| BoilingPtC = 333

| Solubility =

}}

}}

3-Acetyl-6-methoxybenzaldehyde is a chemical compound found in the leaves of Encelia farinosa.{{cite journal | last1 = Gray | first1 = Reed | last2 = Bonner | first2 = James | title = Structure determination and synthesis of a plant growth inhibitor, 3-acetyl-6-methoxybenzaldehyde, found in the leaves of Encelia farinosa | journal = Journal of the American Chemical Society | volume = 70 | issue = 3 | pages = 1249–1253 | year = 1948 | pmid = 18909201 | doi = 10.1021/ja01183a114}}