:3-Fumarylpyruvic acid

{{Chembox

| ImageFile = 3-Fumarylpyruvic acid.svg

| ImageSize = 200px

| ImageAlt =

| PIN = (2E)-4,6-Dioxohept-2-enedioic acid

| OtherNames = (E)-4,6-Dioxohept-2-enedioic acid

| Section1 = {{Chembox Identifiers

| CASNo = 75164-74-8

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 89677-43-0

| CASNo1_Comment = (non-specific)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 454MG36A86

| PubChem = 5280525

| PubChem1 = 6857354

| PubChem1_Comment = (dianion)

| ChEBI = 1506

| KEGG = C02514

| ChemSpiderID = 4444156

| SMILES = OC(=O)\C=C\C(=O)CC(=O)C(O)=O

| InChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13)/b2-1+

| InChIKey =AZCFLHZUFANAOR-OWOJBTEDSA-N

}}

| Section2 = {{Chembox Properties

| C=7|H=6|O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

3-Fumarylpyruvic acid, or 3-fumarylpyruvate, is a dicarboxylic acid formed from the isomerisation of 3-maleylpyruvate by maleylpyruvate isomerase.{{cite journal | author = Lack L | date = 1961 | title = Enzymic cis-trans isomerization of maleylpyruvic acid | journal = J. Biol. Chem. | volume = 236 | issue = 11 | pages = 2835–2840 | doi = 10.1016/S0021-9258(19)76386-8 | pmid=14461395| doi-access = free }} It is converted into fumarate and pyruvate by 3-fumarylpyruvate hydrolase.{{cite journal | title = Molecular and biochemical characterization of the 5-nitroanthranilic acid degradation pathway in Bradyrhizobium sp. strain JS329 |author = Qu, Y. |author2 = Spain, J.C. |name-list-style = amp |journal = J. Bacteriol. |year = 2011 |volume = 193 |issue = 12 |pages = 3057–3063 |pmid = 21498645 |doi=10.1128/JB.01188-10 |pmc=3133195}}