:3-Nitrobenzanthrone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477219884

| ImageFile = 3-Nitrobenzanthrone.png

| ImageSize=

| PIN = 3-Nitro-7H-benzo[de]anthracen-7-one

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2103821

| InChI = 1/C17H9NO3/c19-17-12-5-2-1-4-10(12)11-8-9-15(18(20)21)13-6-3-7-14(17)16(11)13/h1-9H

| InChIKey = QAJOWHGESRCVLY-UHFFFAOYAK

| SMILES1 = [O-][N+](=O)c2c1cccc4c1c(cc2)c3c(cccc3)C4=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H9NO3/c19-17-12-5-2-1-4-10(12)11-8-9-15(18(20)21)13-6-3-7-14(17)16(11)13/h1-9H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QAJOWHGESRCVLY-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 17117-34-9

| PubChem = 2825690

| KEGG = C20824

| UNII = O4OJW7BC7W

| SMILES = O=C2C1=CC=CC=C1C4=C3C2=CC=CC3C([N+]([O-])=O)C=C4

}}

|Section2={{Chembox Properties

| Formula = C₁₇H₉NO₃

| MolarMass = 275.26 g/mol

| Appearance =

| Density =

| MeltingPtC = 248

| MeltingPt_ref = {{cite journal |title=The environmental carcinogen 3-nitrobenzanthrone and its main metabolite 3-aminobenzanthrone enhance formation of reactive oxygen intermediates in human A549 lung epithelial cells |author =Hansen, Tanja |author2 =Seidel, Albrecht |author3 =Borlak, Juergen |journal=Toxicology and Applied Pharmacology |year=2007 |volume=221 |issue=2 |pages=222–234 |doi=10.1016/j.taap.2007.03.003 |pmid=17477947|s2cid =25295474 |url =http://publica.fraunhofer.de/documents/N-60792.html |url-access=subscription }}

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards = extremely carcinogenic

| FlashPt =

| AutoignitionPt = }}

}}

3-Nitrobenzanthrone (3-nitro-7H-benz[de]anthracen-7-one) is a chemical compound emitted in diesel exhaust; it is a potent carcinogen.{{cite journal

| journal = Mutagenesis

| year = 2005

| volume = 20

| issue = 6

| pages = 399–410

| doi = 10.1093/mutage/gei057

| title = 3-Nitrobenzanthrone, a potential human cancer hazard in diesel exhaust and urban air pollution: a review of the evidence

| author = Volker M. Arlt

| pmid = 16199526| doi-access = free| citeseerx = 10.1.1.1001.7655}} It produced the highest score ever reported in the Ames test, a standard measure of the cancer-causing potential of toxic chemicals, far greater than the previous known strongest (1,8-dinitropyrene, which is also found in diesel exhaust).{{cite journal | journal = New Scientist | date = Oct 25, 1997 | pages = 4 |author = Fred Pearce | url=https://www.newscientist.com/article/mg15621050.200-devil-in-the-diesel--lorries-belch-out-what-may-be-the-most.html | title = Devil in the diesel}}