:4',7-Dihydroxyflavone

{{Short description|Chemical compound}}

{{Chembox

| Name = 4′,7-Dihydroxyflavone

| ImageFile = 4',7-Dihydroxyflavone.svg

| ImageSize = 200px

| ImageAlt = Chemical structure of 4′,7-dihydroxyflavone

| IUPACName = 4′,7-Dihydroxyflavone

| SystematicName = 7-Hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one

| OtherNames = 7,4′-Dihydroxyflavone

|Section1={{Chembox Identifiers

| CASNo = 2196-14-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 53ZZF57X0U

| PubChem = 5282073

| ChemSpiderID = 4445298

| ChEBI = 29503

| InChI = 1/C15H10O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-8,16-17H

| InChIKey = LCAWNFIFMLXZPQ-UHFFFAOYAD

| StdInChI = 1S/C15H10O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-8,16-17H

| StdInChIKey = LCAWNFIFMLXZPQ-UHFFFAOYSA-N

| SMILES = C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C=C(C=C3)O)O

}}

|Section2={{Chembox Properties

| C=15 | H=10 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

4′,7-Dihydroxyflavone is a flavone. It is found in Medicago truncatula in relation with the root nodulation symbiont Sinorhizobium meliloti{{Cite journal|doi=10.1111/j.1365-313X.2008.03676.x|pmid=18786000|title=Flavones and flavonols play distinct critical roles during nodulation of Medicago truncatula by Sinorhizobium meliloti|year=2009|last1=Zhang|first1=Juan|last2=Subramanian|first2=Senthil|last3=Stacey|first3=Gary|last4=Yu|first4=Oliver|journal=The Plant Journal|volume=57|pages=171–83|issue=1|doi-access=free}} or in seeds of Sophora viciifolia.{{Cite journal|pmid=9206257|language= Chinese|year=1996|last1=Wang|first1=X|last2=Li|first2=J|last3=Wei|first3=L|last4=Ohmiya|first4=S|title=Flavone constituents in the seeds of Sophora vicii folia Hance|volume=21|issue=3|pages=165–6, 191|journal=Zhongguo Zhong Yao Za Zhi = Zhongguo Zhongyao Zazhi = China Journal of Chinese Materia Medica}}

Like many other flavonoids, 4′,7-dihydroxyflavone has been found to possess activity at opioid receptors in vitro.{{cite journal |vauthors=Katavic PL, Lamb K, Navarro H, Prisinzano TE | title = Flavonoids as opioid receptor ligands: identification and preliminary structure-activity relationships | journal = J. Nat. Prod. | volume = 70 | issue = 8 | pages = 1278–82 | date = August 2007 | pmid = 17685652 | pmc = 2265593 | doi = 10.1021/np070194x }} Specifically, it acts as an antagonist of the μ-opioid receptor and, with lower affinity, of the κ- and δ-opioid receptors.