:4-Dehydroepiandrosterone

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477221469

| ImageFile = 3beta-Hydroxyandrost-4-en-17-one.png

| ImageSize = 250

| ImageAlt = Skeletal formula of 4-dehydroepiandrosterone

| ImageFile1 = 4-Dehydroepiandrosterone 3D ball.png

| ImageAlt1 = Ball-and-stick model of the 4-dehydroepiandrosterone molecule

| ImageSize1 = 250

| IUPACName = 3β-Hydroxyandrost-4-en-17-one

| SystematicName = (3aS,3bR,7S,9aR,9bS,11aS)-7-Hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-one

| OtherNames = Androst-4-en-3β-ol-17-one

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8123501

| SMILES1 = O=C4[C@]3(CC[C@@H]2[C@@]1(C(=C/[C@@H](O)CC1)\CC[C@H]2[C@@H]3CC4)C)C

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1077603

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,13-16,20H,3-10H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VMYTXBKVYDESSJ-USOAJAOKSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 571-44-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8U3PGO66GQ

| PubChem = 9947889

| SMILES = O=C1CC[C@@]2([H])[C@]3([H])CCC4=C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@@]21C

}}

|Section2={{Chembox Properties

| C=19 | H=28 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

4-Dehydroepiandrosterone (4-DHEA) is a steroid that is an isomer of 5-dehydroepiandrosterone.

4-DHEA has been prepared by laboratory synthesis.Klimstra, Paul D.; Colton, F. B. Synthesis of 3β-hydroxyestr-4-en-17-one and 3β-hydroxyandrost-4-en-17-one. Steroids (1967), 10(4), 411-24.Ward, Margaret G.; Orr, James C.; Engel, Lewis L. A convenient synthesis of 3β-hydroxyandrost-4-en-17-one. Journal of Organic Chemistry (1965), 30(5), 1421-3.