:4-MeO-MiPT

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477222495

| ImageFile = 4-MeO-MiPT.svg

| ImageSize2 =

| ImageFile2 = 4-MeO-MiPT 3D.png

| ImageSize =

| PIN = N-[2-(4-Methoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine

| OtherNames = 3-[2-(Isopropylmethylamino)ethyl]-4-methoxyindole

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106243

| InChI = 1/C15H22N2O/c1-11(2)17(3)9-8-12-10-16-13-6-5-7-14(18-4)15(12)13/h5-7,10-11,16H,8-9H2,1-4H3

| InChIKey = BJIWLHLNPTWSGD-UHFFFAOYAK

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 354500

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HU85354AY8

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H22N2O/c1-11(2)17(3)9-8-12-10-16-13-6-5-7-14(18-4)15(12)13/h5-7,10-11,16H,8-9H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BJIWLHLNPTWSGD-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|chemspider}}

| CASNo = 96096-53-6

| PubChem = 29935317

| SMILES = CC(N(CCC1=CNC2=C1C(OC)=CC=C2)C)C

}}

|Section2={{Chembox Properties

| Formula =

| C=15 | H=22 | N=2 | O=1

| MolarMass = 246.35 g/mol

| Appearance =

| Density =

| MeltingPtC = 80-81

| MeltingPt_ref = {{cite journal|last1=Repke|first1=David B.|last2=Grotjahn|first2=Douglas B.|last3=Shulgin|first3=Alexander T.|title=Psychotomimetic N-methyl-N-isopropyltryptamines. Effects of variation of aromatic oxygen substituents|journal=Journal of Medicinal Chemistry|date=July 1985|volume=28|issue=7|pages=892–896|doi=10.1021/jm00145a007|pmid=4009612}}

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

4-MeO-MiPT, or 4-methoxy-N-methyl-N-isopropyltryptamine, is a lesser-known psychedelic drug. It is the 4-methoxy analog of MiPT. 4-MeO-MiPT was first synthesized by Alexander Shulgin and is mentioned in his book TiHKAL (Tryptamines i Have Known And Loved). Subsequent testing by Shulgin on human test subjects showed the effective dose as 20-30 mg (or 0.4 mg per Kg body weight of subject); the onset time between ingestion and the first noticeable effects was 45-60 min, with sensations lasting between 2-2.5 hours. The sensation were significantly milder than those of 4-HO-MiPT, with 4-MeO-MiPT producing erotic-enhancing effects, and few of the visuals common with tryptamines. Very little data exists about the pharmacological properties, metabolism, and toxicity of 4-MeO-MiPT.