:4-Methyl-α-ethyltryptamine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 452179546

| IUPAC_name = 1-(4-Methyl-1H-indol-3-yl)butan-2-amine

| image = 4-Methyl-AET.png

| width = 175px

| image2 = 4-Methyl-AET 3d ballandsticks.gif

| tradename =

| pregnancy_category =

| legal_status = Illegal in Singapore

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 28289-30-7

| CAS_number_Ref = {{Cascite|correct|CAS}}

| ATC_prefix = none

| PubChem = 57466062

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SBF4N6JJ4L

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 26234938

| synonyms =

| C=13 | H=18 | N=2

| smiles = Cc2c1c(CC(N)CC)c[nH]c1ccc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H18N2/c1-3-11(14)7-10-8-15-12-6-4-5-9(2)13(10)12/h4-6,8,11,15H,3,7,14H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XKHCIOVNXOVPIK-UHFFFAOYSA-N

}}

4-Methyl-α-ethyltryptamine (4-Me-αET) is a drug of the tryptamine class.{{cite book | vauthors = Cerletti A, Taeschler M, Weidmann H | title = Pharmacology, Behavior, and Clinical Aspects, Proceedings of a Symposium held at the College of Physicians and Surgeons, Columbia University, New York | chapter = Pharmacologic studies on the structure-activity relationship of hydroxyindole alkylamines | series = Advances in Pharmacology | volume = 6 | issue = Pt B | pages = 233–46 | date = 1968 | pmid = 5658327 | doi = 10.1016/s1054-3589(08)60322-1 | isbn = 978-0-12-032906-9 }} It is a designer drug and is sold online as a "research chemical".{{cite journal| vauthors = Chapman SJ |title=PeakAL: Protons I Have Known and Loved, Too — Another Fifty Shades of Grey-Market Spectra|journal=Blotter|date=1 Mar 2018|issue=5|doi=10.16889/isomerdesign-5|url=https://isomerdesign.com/doi/5/index.php|access-date=3 April 2018|doi-access=free}}