:5-HO-DiPT

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-(2-(diisopropylamino)ethyl)-1H-indol-5-ol

| image = 5-HO-DiPT.svg

| width = 240

| tradename =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 36288-76-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G7I3OBF3XM

| PubChem = 71360804

| ChemSpiderID = 29358411

| smiles = CC(C)N(CCC1=CNC2=C1C=C(C=C2)O)C(C)C

| StdInChI = 1S/C16H24N2O/c1-11(2)18(12(3)4)8-7-13-10-17-16-6-5-14(19)9-15(13)16/h5-6,9-12,17,19H,7-8H2,1-4H3

| StdInChIKey = HWOLNTJLIUHEOG-UHFFFAOYSA-N

| C=16 | H=24 | N=2 | O=1

}}

5-HO-DiPT (5-hydroxy-N,N-di-iso-propyltryptamine) is a tryptamine derivative which acts as a serotonin receptor agonist. It is primarily known as a metabolite of the better known psychoactive drug 5-MeO-DiPT,{{cite journal | vauthors = Yu AM | title = Indolealkylamines: biotransformations and potential drug-drug interactions | journal = The AAPS Journal | volume = 10 | issue = 2 | pages = 242–53 | date = June 2008 | pmid = 18454322 | pmc = 2751378 | doi = 10.1208/s12248-008-9028-5 }} but 5-HO-DiPT has also rarely been encountered as a designer drug in its own right.{{Cite journal | vauthors = Brandt SD, Martins CU | doi = 10.1016/j.trac.2010.04.008 | title = Analytical methods for psychoactive N,N-dialkylated tryptamines | journal = TrAC Trends in Analytical Chemistry | volume = 29 | issue = 8 | pages = 858–869 | year = 2010 }} Tests in vitro show 5-HO-DiPT to have high 5-HT_2A affinity and good selectivity over 5-HT_1A,{{cite journal | vauthors = McKenna DJ, Repke DB, Lo L, Peroutka SJ | title = Differential interactions of indolealkylamines with 5-hydroxytryptamine receptor subtypes | journal = Neuropharmacology | volume = 29 | issue = 3 | pages = 193–8 | date = March 1990 | pmid = 2139186 | doi = 10.1016/0028-3908(90)90001-8 | s2cid = 24188017 | doi-access = free }} while being more lipophilic than the related drug bufotenine (5-HO-DMT), which produces mainly peripheral effects.