:5-MeS-DMT

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477225115

| ImageFile = 5-MeS-DMT.svg

| ImageSize = 120px

| PIN = N,N-Dimethyl-2-[5-(methylsulfanyl)-1H-indol-3-yl]ethan-1-amine

| OtherNames = 5-Methylthio-N,N-dimethyltryptamine

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 19917

| InChI = 1/C13H18N2S/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3

| InChIKey = YOGJZQGRTVMCPY-UHFFFAOYAL

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 31783

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H18N2S/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YOGJZQGRTVMCPY-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 5102-11-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8E8PJ79K57

| PubChem = 21180

| SMILES = CN(CCC1=CNC2=C1C=C(SC)C=C2)C

}}

|Section2={{Chembox Properties

| C=13 | H=18 | N=2 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

5-MeS-DMT (5-methylthio-N,N-dimethyltryptamine) is a lesser-known psychedelic drug. It is the 5-methylthio analog of dimethyltryptamine (DMT). 5-MeS-DMT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), the minimum dosage is listed as 15-30 mg.[http://www.erowid.org/library/books_online/tihkal/tihkal46.shtml 5-MeS-DMT Entry in TIHKAL] The duration listed as very short (less than one hour), just like DMT. 5-MeS-DMT produces similar effects to DMT, but weaker. Shulgin describes his feelings while on a low dose of this drug as "pointlessly stoned", although at a higher dose of 20 mg he says it is "quite intense" and suggests that a higher dose still might have full activity.

5-MeS-DMT has been the subject of only limited clinical testing, with several small behavioral studies in rats indicating that it is a less potent than 5-MeO-DMT or 4-hydroxy-DMT (psilocin) but more effective than either 4-MeO-DMT or 4-MeS-DMT.{{cite journal|last1=Glennon|first1=R.A.|last2=Young|first2=R.|last3=Benington|first3=F.|last4=Morin|first4=R.D.|title=Hallucinogens as discriminative stimuli: A comparison of 4-OMe and 5-OMe DMT with their methylthio counterparts|journal=Life Sciences|date=February 1982|volume=30|issue=5|pages=465–467|doi=10.1016/0024-3205(82)90463-5|pmid=6801410}}{{cite journal |author =Kline TB |author2 =Benington F |author3 =Morin RD |author4 =Beaton JM |title=Structure-activity relationships in potentially hallucinogenic N,N-dialkyltryptamines substituted in the benzene moiety |journal=Journal of Medicinal Chemistry |volume=25 |issue=8 |pages=908–13 |date=August 1982 |pmid=7120280 |doi= 10.1021/jm00350a005}}{{cite journal |author =Kline TB |author2 =Benington F |author3 =Morin RD |author4 =Beaton JM |author5 =Glennon RA |author6 =Domelsmith LN |author7 =Houk KN |author8 =Rozeboom MD |title=Structure-activity relationships for hallucinogenic N,N-dialkyltryptamines: photoelectron spectra and serotonin receptor affinities of methylthio and methylenedioxy derivatives |journal=Journal of Medicinal Chemistry |volume=25 |issue=11 |pages=1381–3 |date=November 1982 |pmid=6815326 |doi= 10.1021/jm00353a021}}