:8A-PDHQ

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477227464

| IUPAC_name = 8a-phenyldecahydroquinoline

| image = Phenyldecahydroquinoline.svg

| width = 150

| tradename =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 131556-11-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8GBT78N4EC

| PubChem = 131397

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 116144

| C=15 | H=21 | N=1

| smiles = C1([C@]23CCCC[C@H]2CCCN3)=CC=CC=C1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H21N/c1-2-7-13(8-3-1)15-11-5-4-9-14(15)10-6-12-16-15/h1-3,7-8,14,16H,4-6,9-12H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QEXADSRMRUUCQJ-UHFFFAOYSA-N

}}

8a-Phenyldecahydroquinoline (8A-PDHQ) is a high affinity NMDA antagonist developed by a team at Parke Davis in the 1950s.US Patent 3035059 It is a structural analog of phencyclidine with slightly lower binding affinity than the parent compound. (−)-8a-Phenyldecahydroquinoline has an in vivo potency comparable to that of (+)-MK-801.{{cite journal | vauthors = Chen C, Kozikowski AP, Wood PL, Reynolds IJ, Ball RG, Pang YP | title = Synthesis and biological activity of 8a-phenyldecahydroquinolines as probes of PCP's binding conformation. A new PCP-like compound with increased in vivo potency | journal = Journal of Medicinal Chemistry | volume = 35 | issue = 9 | pages = 1634–8 | date = May 1992 | pmid = 1315871 | doi = 10.1021/jm00087a020 }}{{cite journal | vauthors = Elhallaoui M, Laguerre M, Carpy A, Ouazzani FC | title = Molecular modeling of noncompetitive antagonists of the NMDA receptor: proposal of a pharmacophore and a description of the interaction mode | journal = Journal of Molecular Modeling | volume = 8 | issue = 2 | pages = 65–72 | date = February 2002 | pmid = 12032600 | doi = 10.1007/s00894-001-0067-4 | s2cid = 34882820 }}