:ABT-670

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 456505806

| IUPAC_name = 3-methyl-N-(1-oxy-3',4',5',6'-tetrahydro-2'H-[2,4'-bipyridine]-1'-ylmethyl)benzamide

| image = ABT-670 Structure.svg

| width =

| tradename =

| licence_EU =

| pregnancy_category =

| legal_UK =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 630119-43-6

| ATC_suffix =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 4L6071XH2J

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 219182

| PubChem = 16094676

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 17252978

| C=19 | H=23 | N=3 | O=2

| smiles = [O-][n+]1ccccc1C(CC3)CCN3CNC(=O)c(c2)cccc2C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H23N3O2/c1-15-5-4-6-17(13-15)19(23)20-14-21-11-8-16(9-12-21)18-7-2-3-10-22(18)24/h2-7,10,13,16H,8-9,11-12,14H2,1H3,(H,20,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PUMMPCXNEPHBNN-UHFFFAOYSA-N

}}

ABT-670 is a drug which acts as a potent, orally bioavailable dopamine agonist selective for the D4 subtype, which was developed as a possible treatment for erectile dysfunction,{{cite journal | vauthors = Patel MV, Kolasa T, Mortell K, Matulenko MA, Hakeem AA, Rohde JJ, Nelson SL, Cowart MD, Nakane M, Miller LN, Uchic ME, Terranova MA, El-Kouhen OF, Donnelly-Roberts DL, Namovic MT, Hollingsworth PR, Chang R, Martino BR, Wetter JM, Marsh KC, Martin R, Darbyshire JF, Gintant G, Hsieh GC, Moreland RB, Sullivan JP, Brioni JD, Stewart AO | display-authors = 6 | title = Discovery of 3-methyl-N-(1-oxy-3',4',5',6'-tetrahydro-2'H-[2,4'-bipyridine]-1'-ylmethyl)benzamide (ABT-670), an orally bioavailable dopamine D4 agonist for the treatment of erectile dysfunction | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 25 | pages = 7450–65 | date = December 2006 | pmid = 17149874 | doi = 10.1021/jm060662k }} although its current uses are limited to scientific research.{{cite journal | vauthors = Richards N, Wayman C, Allers KA | title = Electrophysiological actions of the dopamine agonist apomorphine in the paraventricular nucleus during penile erection | journal = Neuroscience Letters | volume = 465 | issue = 3 | pages = 242–7 | date = November 2009 | pmid = 19733217 | doi = 10.1016/j.neulet.2009.08.078 | s2cid = 27767274 }}

See also

References

{{Reflist}}

{{Drugs for erectile dysfunction and PE}}

{{Dopaminergics}}

{{DEFAULTSORT:Abt-670}}

Category:Dopamine agonists

Category:Piperidines

Category:Amine oxides

Category:2-Pyridyl compounds

{{genito-urinary-drug-stub}}