:Abanoquil

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 438873744

| IUPAC_name = 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6,7-dimethoxyquinolin-4-amine

| image = Abanoquil Structure.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 90402-40-7

| ATC_prefix = none

| ATC_suffix =

| PubChem = 164089

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 143896

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F738MWY53L

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 324090

| C=22 | H=25 | N=3 | O=4

| smiles = COC1=C(C=C2CN(CCC2=C1)C3=NC4=CC(=C(C=C4C(=C3)N)OC)OC)OC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H25N3O4/c1-26-18-7-13-5-6-25(12-14(13)8-19(18)27-2)22-10-16(23)15-9-20(28-3)21(29-4)11-17(15)24-22/h7-11H,5-6,12H2,1-4H3,(H2,23,24)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ANZIISNSHPKVRV-UHFFFAOYSA-N

}}

Abanoquil (INN) is an α1-adrenergic receptor antagonist.{{cite journal | vauthors = Tham TC, Guy S, Shanks RG, Harron DW | title = Dose-dependent alpha 1-adrenoceptor antagonist activity of the anti-arrhythmic drug, abanoquil (UK-52,046), without reduction in blood pressure in man | journal = British Journal of Clinical Pharmacology | volume = 33 | issue = 4 | pages = 405–9 | date = April 1992 | pmid = 1349492 | pmc = 1381330 | doi = 10.1111/j.1365-2125.1992.tb04059.x }}