:Abarelix

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477237014

| IUPAC_name = N-acetyl-3-(2-naphthyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridyl)-D-alanyl-L-seryl-N-methyl-L-tyrosyl-D-asparagyl-L-leucyl-N6-isopropyl-L-lysyl-L-prolyl-D-alaninamide{{cite web| title=Abarelix| website=PubChem| date=2017-07-29| url=https://pubchem.ncbi.nlm.nih.gov/compound/Abarelix}}

| image = Abarelix.svg

| width = 250px

| tradename = Plenaxis

| Drugs.com = {{drugs.com|monograph|abarelix}}

| pregnancy_US = X

| legal_status =

| routes_of_administration = Intramuscular injection

| class = GnRH analogue; GnRH antagonist; Antigonadotropin

| bioavailability =

| protein_bound = 96–99%

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 183552-38-7

| CAS_supplemental =

| ATC_prefix = L02

| ATC_suffix = BX01

| ATC_supplemental =

| PubChem = 16131215

| IUPHAR_ligand = 1188

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00106

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10482301

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W486SJ5824

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02738

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 337298

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1252

| synonyms =

| C=72 | H=95 | Cl=1 | N=14 | O=14

| SMILES = CC(C)C[C@H](NC(=O)[C@@H](CC(N)=O)NC(=O)[C@H](Cc1ccc(O)cc1)N(C)C(=O)[C@H](CO)NC(=O)[C@@H](Cc2cccnc2)NC(=O)[C@@H](Cc3ccc(Cl)cc3)NC(=O)[C@@H](NCc5ccc4ccccc4c5)NC(C)=O)C(=O)N[C@@H](CCCCNC(C)C)C(=O)N6CCC[C@H]6C(=O)N[C@H](C)C(N)=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C72H95ClN14O14/c1-41(2)32-54(64(93)80-53(17-10-11-30-77-42(3)4)72(101)87-31-13-18-60(87)69(98)78-43(5)63(75)92)81-68(97)58(38-62(74)91)84-70(99)61(37-46-22-27-52(90)28-23-46)86(7)71(100)59(40-88)85-67(96)57(36-48-14-12-29-76-39-48)83-66(95)56(34-45-20-25-51(73)26-21-45)82-65(94)55(79-44(6)89)35-47-19-24-49-15-8-9-16-50(49)33-47/h8-9,12,14-16,19-29,33,39,41-43,53-61,77,88,90H,10-11,13,17-18,30-32,34-38,40H2,1-7H3,(H2,74,91)(H2,75,92)(H,78,98)(H,79,89)(H,80,93)(H,81,97)(H,82,94)(H,83,95)(H,84,99)(H,85,96)/t43-,53+,54+,55-,56-,57-,58-,59+,60+,61+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AIWRTTMUVOZGPW-HSPKUQOVSA-N

}}

Abarelix, sold under the brand name Plenaxis, is an injectable gonadotropin-releasing hormone antagonist (GnRH antagonist) which is marketed in Germany and the Netherlands. It is primarily used in oncology to reduce the amount of testosterone made in patients with advanced symptomatic prostate cancer for which no other treatment options are available.{{cite web | work = Drugs.com | url = https://www.drugs.com/mtm/abarelix.html | title = Abarelix | access-date = 2018-01-23 | archive-date = 2018-02-10 | archive-url = https://web.archive.org/web/20180210163254/https://www.drugs.com/mtm/abarelix.html | url-status = dead }}{{cite journal | vauthors = Boccon-Gibod L, van der Meulen E, Persson BE | title = An update on the use of gonadotropin-releasing hormone antagonists in prostate cancer | journal = Therapeutic Advances in Urology | volume = 3 | issue = 3 | pages = 127–40 | date = June 2011 | pmid = 21904569 | pmc = 3159401 | doi = 10.1177/1756287211414457 }}

It was originally marketed by Praecis Pharmaceuticals as Plenaxis, and is now marketed by Speciality European Pharma in GermanyPharmazeutische Zeitung online: [http://www.pharmazeutische-zeitung.de/index.php?id=4760 Abarelix] {{in lang|de}} after receiving a marketing authorization in 2005. The drug was introduced in the United States in 2003, but was discontinued in this country in May 2005 due to poor sales and a higher-than-expected incidence of severe allergic reactions.{{cite book| first = Boris | last = Minev | name-list-style = vanc |title=Cancer Management in Man: Chemotherapy, Biological Therapy, Hyperthermia and Supporting Measures|url=https://books.google.com/books?id=mOdKDLAAd0AC&pg=PA182|date=13 January 2011|publisher=Springer Science & Business Media|isbn=978-90-481-9704-0|pages=182–}} It remains marketed in Germany and the Netherlands however.{{cite web | title = Abarelix | url = https://www.drugs.com/international/abarelix.html | work = Drugs.com | access-date = 2018-08-27 | archive-date = 2019-08-29 | archive-url = https://web.archive.org/web/20190829113846/https://www.drugs.com/international/abarelix.html | url-status = dead }}

See also

References

{{Reflist}}

{{GnRH and gonadotropins}}

{{GnRH and gonadotropin receptor modulators}}

Category:GnRH antagonists

Category:Peptide therapeutics

{{pharma-stub}}