:Abunidazole

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477237515

| ImageFile = Abunidazole.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 200

| ImageName = Partially condensed, Kekulé, skeletal formula of abunidazole

| IUPACName = 4-tert-Butyl-2-[hydroxy-(1-methyl-5-nitroimidazol-2-yl)methyl]phenol

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 91017-58-2

| PubChem = 170365

| ChemSpiderID = 148962

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChEMBL = 301926

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| SMILES = Cn1c(N(=O)=O)cnc1C(O)c2cc(C(C)(C)C)ccc2O

| StdInChI = 1S/C15H19N3O4/c1-15(2,3)9-5-6-11(19)10(7-9)13(20)14-16-8-12(17(14)4)18(21)22/h5-8,13,19-20H,1-4H3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| InChI = 1/C15H19N3O4/c1-15(2,3)9-5-6-11(19)10(7-9)13(20)14-16-8-12(17(14)4)18(21)22/h5-8,13,19-20H,1-4H3

| StdInChIKey = DBOZSKOENGSGEJ-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| InChIKey = DBOZSKOENGSGEJ-UHFFFAOYAQ

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6EH821150I

}}

| Section2 = {{Chembox Properties

| C=15 | H=19 | N=3 | O=4

| LogP = 2.815

| pKa = 9.567

| pKb = 4.430

| Density = 1.303 g/mL

}}

}}

Abunidazole (INN) is a nitroimidazole antifungal medication.{{cite web|url=https://gsrs.ncats.nih.gov/app/substance/6EH821150I|title=Abunidazole|publisher=National Institutes of Health|accessdate=6 May 2021}} It was named in 1984{{cite journal|url=https://www.who.int/medicines/publications/druginformation/innlists/PL52.pdf|journal=WHO Chronicle|volume=38|issue=4|year=1984|title=International Nonproprietary Names for Pharmaceutical Substances – Proposed International Nonproprietary Names (Prop. INN): List 52|page=1}} but apparently never marketed.