:Actinoquinol
{{Chembox
| Name =
| ImageFile = Actinoquinol.svg
| ImageSize = 120px
| PIN = 8-Ethoxyquinoline-5-sulfonic acid
| OtherNames =
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo = 15301-40-3
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 470VQE23O3
| EINECS = 239-334-9
| PubChem = 23674
| ChemSpiderID = 22136
| ChEMBL = 1356732
| SMILES = CCOC1=C2C(=C(C=C1)S(=O)(=O)O)C=CC=N2
| InChI = 1/C11H11NO4S/c1-2-16-9-5-6-10(17(13,14)15)8-4-3-7-12-11(8)9/h3-7H,2H2,1H3,(H,13,14,15)
| InChIKey = YAMVZYRZAMBCED-UHFFFAOYAL
| StdInChI = 1S/C11H11NO4S/c1-2-16-9-5-6-10(17(13,14)15)8-4-3-7-12-11(8)9/h3-7H,2H2,1H3,(H,13,14,15)
| StdInChIKey = YAMVZYRZAMBCED-UHFFFAOYSA-N
| RTECS =
| MeSHName =
| ChEBI =
| KEGG = D02761
}}
|Section2={{Chembox Properties
| C=11 | H=11 | N=1 | O=4 | S=1
| Appearance =
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent =
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb =
}}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape =
}}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =
}}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US =
}}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor =
}}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| LD50 =
| PEL =
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds =
}}
}}
Actinoquinol is a chemical compound that absorbs UVB light.{{cite journal | pmid= 22480421 | title = Central corneal thickness considered an index of corneal hydration of the UVB irradiated rabbit cornea as influenced by UVB absorber | volume=61 | issue=3 | date=July 2012 | journal=Physiol Res | pages=299–306| last1 = Cejka | first1 = C. | last2 = Luyckx | first2 = J. | last3 = Cejková | first3 = J. | doi = 10.33549/physiolres.932242 | doi-access = free }}