:Actinoquinol

{{Chembox

| Name =

| ImageFile = Actinoquinol.svg

| ImageSize = 120px

| PIN = 8-Ethoxyquinoline-5-sulfonic acid

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo = 15301-40-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 470VQE23O3

| EINECS = 239-334-9

| PubChem = 23674

| ChemSpiderID = 22136

| ChEMBL = 1356732

| SMILES = CCOC1=C2C(=C(C=C1)S(=O)(=O)O)C=CC=N2

| InChI = 1/C11H11NO4S/c1-2-16-9-5-6-10(17(13,14)15)8-4-3-7-12-11(8)9/h3-7H,2H2,1H3,(H,13,14,15)

| InChIKey = YAMVZYRZAMBCED-UHFFFAOYAL

| StdInChI = 1S/C11H11NO4S/c1-2-16-9-5-6-10(17(13,14)15)8-4-3-7-12-11(8)9/h3-7H,2H2,1H3,(H,13,14,15)

| StdInChIKey = YAMVZYRZAMBCED-UHFFFAOYSA-N

| RTECS =

| MeSHName =

| ChEBI =

| KEGG = D02761

}}

|Section2={{Chembox Properties

| C=11 | H=11 | N=1 | O=4 | S=1

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Actinoquinol is a chemical compound that absorbs UVB light.{{cite journal | pmid= 22480421 | title = Central corneal thickness considered an index of corneal hydration of the UVB irradiated rabbit cornea as influenced by UVB absorber | volume=61 | issue=3 | date=July 2012 | journal=Physiol Res | pages=299–306| last1 = Cejka | first1 = C. | last2 = Luyckx | first2 = J. | last3 = Cejková | first3 = J. | doi = 10.33549/physiolres.932242 | doi-access = free }}

References

{{reflist}}

Category:Quinolines

Category:Sulfonic acids

{{organic-compound-stub}}