:Aglepristone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8S,11R,13S,14S,17R)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-17-[(Z)-prop-1-enyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one

| image = Aglepristone.png

| width = 225px

| tradename = Alizin

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Antiprogestogen; Antiglucocorticoid

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 124478-60-0

| CAS_supplemental =

| ATC_prefix = G03

| ATC_suffix = XB90

| ATC_supplemental =

| PubChem = 14153279

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16736563

| UNII = 0UT4JLE1CM

| KEGG = D07096

| ChEBI =

| ChEMBL = 2103998

| synonyms = RU-46534; RU-534; 11β-[4-(Dimethylamino)phenyl]-17β-hydroxy-17α-[(Z)-propenyl]estra-4,9-dien-3-one

| C=29 | H=37 | N=1 | O=2

| SMILES = C/C=C\[C@@]1(CC[C@@H]2[C@@]1(C[C@@H](C3=C4CCC(=O)C=C4CC[C@@H]23)C5=CC=C(C=C5)N(C)C)C)O

| StdInChI_Ref =

| StdInChI = 1S/C29H37NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h5-7,9-10,15,17,24-26,32H,8,11-14,16,18H2,1-4H3/b15-5-/t24-,25+,26-,28-,29-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = RTCKAOKDXNYXEH-FWSJOHTJSA-N

}}

Aglepristone ({{abbrlink|INN|International Nonproprietary Name}}) (brand name Alizin; former developmental code names RU-46534, RU-534) is a synthetic, steroidal antiprogestogen related to mifepristone which is marketed by Virbac in several European countries for use in veterinary medicine.{{cite book| vauthors = Kaufman LK, Baldwin CJ | chapter = Pregnancy Loss in the Bitch and Queen | veditors = Bonagura JD, Twedt DC |title=Kirk's Current Veterinary Therapy XV| chapter-url = https://books.google.com/books?id=KlJKAgAAQBAJ&pg=PT3009|date=1 December 2013|publisher=Elsevier Health Sciences|isbn=978-0-323-22762-9|pages=3009–}}{{cite book| vauthors = Squires EJ | chapter = Endocrine manipulation of reproduction. |title=Applied Animal Endocrinology| chapter-url=https://books.google.com/books?id=Q-rP6Fc9-N4C&pg=PA207|year=2010|publisher=CABI|isbn=978-1-84593-755-3|pages=207–}}{{cite book | chapter = Aglepristone | vauthors = Papich MC |title=Saunders Handbook of Veterinary Drugs: Small and Large Animal| chapter-url = https://books.google.com/books?id=PeJTVfaAiYAC&pg=PT120|date=3 November 2010|publisher=Elsevier Health Sciences|isbn=978-1-4377-0192-0|pages=120–}} It is specifically used as an abortifacient in pregnant animals.{{cite journal | vauthors = Fieni F, Martal J, Marnet PG, Siliart B, Bernard F, Riou M, Bruyas JF, Tainturier D | title = Hormonal variation in bitches after early or mid-pregnancy termination with aglepristone (RU534) | journal = Journal of Reproduction and Fertility. Supplement | volume = 57 | issue = | pages = 243–8 | date = 2001 | pmid = 11787157 | doi = | url = | veditors = Concannon PW | series =Advances in reproduction in dogs, cats and exotic carnivores: proceedings of the fourth International Symposium on Canine and Feline Reproduction, Oslo, Norway, 29 June-1 July 2000 |isbn=978-0-906545-37-9 }} Aglepristone, similarly to mifepristone, also possesses some antiglucocorticoid activity.{{cite journal | vauthors = Batista M, Reyes R, Santana M, Alamo D, Vilar J, González F, Cabrera F, Gracia A | display-authors = 6 | title = Induction of parturition with aglepristone in the Majorera goat | journal = Reproduction in Domestic Animals = Zuchthygiene | volume = 46 | issue = 5 | pages = 882–888 | date = October 2011 | pmid = 21320179 | doi = 10.1111/j.1439-0531.2011.01759.x }}{{cite journal | vauthors = Baan M, Taverne MA, de Gier J, Kooistra HS, Kindahl H, Dieleman SJ, Okkens AC | title = Hormonal changes in spontaneous and aglépristone-induced parturition in dogs | journal = Theriogenology | volume = 69 | issue = 4 | pages = 399–407 | date = March 2008 | pmid = 18054071 | doi = 10.1016/j.theriogenology.2007.10.008 }}