:Alafosfalin

{{Chembox

| ImageFile = Alaphosphin.svg

| ImageAlt =

| IUPACName = ((1R)-1-(((2S)-2-Aminopropanoyl)amino]ethyl)phosphonic acid

| OtherNames = Alaphosphin

|Section1={{Chembox Identifiers

| CASNo = 60668-24-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0M8OM373BS

| PubChem = 71957

| SMILES = C[C@@H](C(=O)N[C@@H](C)P(=O)(O)O)N

| ChemSpiderID = 64964

| InChI = 1/C5H13N2O4P/c1-3(6)5(8)7-4(2)12(9,10)11/h3-4H,6H2,1-2H3,(H,7,8)(H2,9,10,11)/t3-,4+/m0/s1

| InChIKey = BHAYDBSYOBONRV-IUYQGCFVBQ

| StdInChI = 1S/C5H13N2O4P/c1-3(6)5(8)7-4(2)12(9,10)11/h3-4H,6H2,1-2H3,(H,7,8)(H2,9,10,11)/t3-,4+/m0/s1

| StdInChIKey = BHAYDBSYOBONRV-IUYQGCFVSA-N}}

|Section2={{Chembox Properties

| C = 5 | H = 13 | N = 2 | O = 4 | P = 1

| Appearance =

| Density =

| MeltingPtC = 295-297

| MeltingPt_notes = (decomp)

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Alafosfalin, also known as alaphosphin, is an phosphonodipeptide with antibacterial{{cite journal|last1=Atherton|first1=Frank R.|last2=Hassall|first2=Cedric H.|last3=Lambert|first3=Robert W.|title=Synthesis and structure-activity relationships of antibacterial phosphonopeptides incorporating (1-aminoethyl)phosphonic acid and (aminomethyl)phosphonic acid|journal=Journal of Medicinal Chemistry|date=January 1986|volume=29|issue=1|pages=29–40|doi=10.1021/jm00151a005|pmid=3510298 }} and antifungal{{cite journal|last1=Khomutov|first1=Radii M.|last2=Osipova|first2=Tatyana I.|last3=Khurs|first3=Elena N.|last4=Dzhavakhiya|first4=Vitalii G.|title=Synthesis of alafosfalin and its phosphinic analogue and their fungicidal activity|journal=Mendeleev Communications|date=November 2008|volume=18|issue=6|pages=295–296|doi=10.1016/j.mencom.2008.11.001}} properties.