:Aleuritin

{{Chembox

| ImageFile = Aleuritin.svg

| ImageSize = 250px

| ImageAlt = chemical structure of aleuritin

| IUPACName = 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-8H-[1,4]dioxino[2,3-f]chromen-8-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 124901-94-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 53U6TM93FE

| PubChem = 139031048

| SMILES = COc1cc(cc(OC)c1O)C2Oc3c(OC2CO)c4C=CC(=O)Oc4cc3OC

| StdInChI=1S/C21H20O9/c1-25-13-6-10(7-14(26-2)18(13)24)19-16(9-22)29-20-11-4-5-17(23)28-12(11)8-15(27-3)21(20)30-19/h4-8,16,19,22,24H,9H2,1-3H3

| StdInChIKey = ITFXDKZROOJSKV-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula = C21H20O9

| MolarMass = 416.37 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Aleuritin is a coumarinolignoid found in the tree Aleurites fordii.{{ cite journal |author1=Fozdar, B. I. |author2=Khan, S. A. |author3=Shamsuddin, T. |author4=Shamsuddin, K. M. |author5=Kintzinger, J. | title = Aleuritin, a Coumarinolignoid, and a Coumarin from Aleurites fordii | journal = Phytochemistry | year = 1989 | volume = 28 | issue = 9 | pages = 2459–61 | doi = 10.1016/S0031-9422(00)98005-1 |bibcode=1989PChem..28.2459F }}

References