:Aleuritin
{{Chembox
| ImageFile = Aleuritin.svg
| ImageSize = 250px
| ImageAlt = chemical structure of aleuritin
| IUPACName = 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-8H-[1,4]dioxino[2,3-f]chromen-8-one
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 124901-94-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 53U6TM93FE
| PubChem = 139031048
| SMILES = COc1cc(cc(OC)c1O)C2Oc3c(OC2CO)c4C=CC(=O)Oc4cc3OC
| StdInChI=1S/C21H20O9/c1-25-13-6-10(7-14(26-2)18(13)24)19-16(9-22)29-20-11-4-5-17(23)28-12(11)8-15(27-3)21(20)30-19/h4-8,16,19,22,24H,9H2,1-3H3
| StdInChIKey = ITFXDKZROOJSKV-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| Formula = C21H20O9
| MolarMass = 416.37 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Aleuritin is a coumarinolignoid found in the tree Aleurites fordii.{{ cite journal |author1=Fozdar, B. I. |author2=Khan, S. A. |author3=Shamsuddin, T. |author4=Shamsuddin, K. M. |author5=Kintzinger, J. | title = Aleuritin, a Coumarinolignoid, and a Coumarin from Aleurites fordii | journal = Phytochemistry | year = 1989 | volume = 28 | issue = 9 | pages = 2459–61 | doi = 10.1016/S0031-9422(00)98005-1 |bibcode=1989PChem..28.2459F }}