:Alletorphine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477365067

| IUPAC_name = (5α,6β,14β,18R)-18-[(1S)-1-hydroxy-1-methylbutyl]-6-methoxy-17-prop-2-en-1-yl-7,8-didehydro-18,19-dihydro-4,5-epoxy-6,14-ethenomorphinan-3-ol

| image = Alletorphine.svg

| width = 180

| image2 = Alletorphine ball-and-stick animation.gif

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 23758-80-7

| ATC_prefix = None

| ATC_suffix =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4UWR086NOA

| PubChem = 72090

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104628

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16736565

| C = 27 | H = 35 | N = 1 | O = 4

| smiles = C[C@](O)(CCC)[C@H]6C[C@]42/C=C/[C@]6(OC)[C@@H]3Oc5c1c(C[C@H]4N(CC[C@@]123)CC=C)ccc5O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C27H35NO4/c1-5-9-24(3,30)19-16-25-10-11-27(19,31-4)23-26(25)12-14-28(13-6-2)20(25)15-17-7-8-18(29)22(32-23)21(17)26/h6-8,10-11,19-20,23,29-30H,2,5,9,12-16H2,1,3-4H3/t19-,20-,23-,24+,25-,26+,27-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OSQIRUUENNTOQL-GCZKJHQNSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Alletorphine (INN; M-218, R&S-218-M), or N-allylnoretorphine, is an opioid analgesic of the oripavine series which was never marketed.{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA50 | accessdate = 29 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 50}}{{cite book | vauthors = Morton IK, Hall JM | title = Concise dictionary of pharmacological agents: properties and synonyms | url = https://books.google.com/books?id=mqaOMOtk61IC&pg=PA11 | accessdate = 29 November 2011 | year = 1999 | publisher = Springer | isbn = 978-0-7514-0499-9 | page = 11}}