:Alnusiin
{{chembox
| verifiedrevid =
| Name = Alnusiin
| ImageFile = Alnusiin.png
| ImageName = Chemical structure of alnusiin
| IUPACName =
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref =
| CASNo = 78836-99-4
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref =
| ChEMBL =
| ChemSpiderID = 4445026
| InChI = 1/C41H26O26/c42-12-1-7-18(26(51)22(12)47)19-8(2-13(43)23(48)27(19)52)39(58)67-35-34(66-38(7)57)32-17(62-41(35)60)6-61-36(55)11-5-14(44)24(49)29(54)30(11)63-31-16(46)4-9-20(28(31)53)21-10(40(59)64-32)3-15(45)25(50)33(21)65-37(9)56/h1-5,17,32,34-35,41-54,60H,6H2/t17-,32-,34+,35-,41?/m1/s1
| InChIKey = OAZHOQDMOPZBMN-RBKPYHMIBF
| StdInChI = 1S/C41H26O26/c42-12-1-7-18(26(51)22(12)47)19-8(2-13(43)23(48)27(19)52)39(58)67-35-34(66-38(7)57)32-17(62-41(35)60)6-61-36(55)11-5-14(44)24(49)29(54)30(11)63-31-16(46)4-9-20(28(31)53)21-10(40(59)64-32)3-15(45)25(50)33(21)65-37(9)56/h1-5,17,32,34-35,41-54,60H,6H2/t17-,32-,34+,35-,41?/m1/s1
| StdInChIKey = OAZHOQDMOPZBMN-RBKPYHMISA-N
| KEGG_Ref =
| KEGG =
| PubChem = 5281709
| SMILES = C1C2C(C3C(C(O2)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)OC(=O)C6=CC(=C(C7=C6C8=C(C(=C(C=C8C(=O)O7)O)OC9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)O
| UNII_Ref =
| UNII =
}}
|Section2={{Chembox Properties
| Formula = C41H26O26
| MolarMass = 934.63 g/mol
| Density =
| MeltingPt =
| BoilingPt =
}}
}}
Alnusiin is an ellagitannin found in Alnus sieboldiana.Structures of alnusiin and bicornin, new hydrolyzable tannins having a monolactonized tergalloyl group. Yoshida T, Yazaki K, Memon M.U, Maruyama I, Kurokawa K, Shingu T and Okuda T, Chemical and pharmaceutical bulletin, 1989, volume 37, number 10, pages 2655-2660, {{INIST|19467830}} ([http://ci.nii.ac.jp/naid/110003627299 abstract])
The molecules of gallic acid, luteic acid and hexahydroxydiphenic acid are present in the structure of alnusiin, bound to a glucose residue.