:Alpinetin

{{cs1 config|name-list-style=vanc}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457807247

| Name =Alpinetin

| ImageFile = Alpinetin.svg

| IUPACName = (2S)-7-Hydroxy-5-methoxyflavan-4-one

| SystematicName = (2S)-7-Hydroxy-5-methoxy-2-phenyl-2,3-dihydro-4H-1-benzopyran-4-one

| OtherNames = (2S)-7-Hydroxy-5-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo = 36052-37-6

| CASNo_Ref = {{cascite|changed|??}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SX3EL59QD8

| EINECS =

| PubChem = 154279

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 537954

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 135938

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14O4/c1-19-14-7-11(17)8-15-16(14)12(18)9-13(20-15)10-5-3-2-4-6-10/h2-8,13,17H,9H2,1H3/t13-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QQQCWVDPMPFUGF-ZDUSSCGKSA-N

| SMILES = O=C2c3c(O[C@H](c1ccccc1)C2)cc(O)cc3OC

| InChI = InChI=1S/C16H14O4/c1-19-14-7-11(17)8-15-16(14)12(18)9-13(20-15)10-5-3-2-4-6-10/h2-8,13,17H,9H2,1H3/t13-/m0/s1

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 449909

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| C=16 | H=14 | O=4

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Alpinetin is a phytochemical isolated from a variety of plants including those of the genus Alpinia.{{cite journal |author1=Kimura, Yushiro |author2=Takahashi, Shuhichi |author3=Yoshida, Ikuo | title = Constituents of Alpinia. XII. Constituents of the seeds of A. katsumadai. I. The structure of cardamomin | journal = Yakugaku Zasshi | year = 1968 | volume = 88 | issue = 2 | pages = 239–241|pmid=5692492 | doi=10.1248/yakushi1947.88.2_239| doi-access = free }} It is going through tests to see if it is a vasorelaxant.{{cite journal |vauthors=Wang ZT, Lau CW, Chan FL, Yao X, Chen ZY, He ZD, Huang Y| title = Vasorelaxant effects of cardamonin and alpinetin from Alpinia henryi K. Schum. | journal = J Cardiovasc Pharmacol | year = 2001 | volume = 37| issue = 5 | pages = 596–606|pmid=11336110 | doi=10.1097/00005344-200105000-00011| doi-access = free }}