:Amixetrine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451555297

| IUPAC_name = 1-[2-(3-methylbutoxy)-2-phenylethyl]pyrrolidine

| image = Amixetrine.png

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 24622-72-8

| ATC_prefix = none

| ATC_suffix =

| PubChem = 71911

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64922

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104080

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7UL287YTPJ

| C=17 | H=27 | N=1 | O=1

| smiles = O(CCC(C)C)C(c1ccccc1)CN2CCCC2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H27NO/c1-15(2)10-13-19-17(14-18-11-6-7-12-18)16-8-4-3-5-9-16/h3-5,8-9,15,17H,6-7,10-14H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ISRODTBNJUAWEJ-UHFFFAOYSA-N

}}

Amixetrine (INN; brand name Somagest; developmental code CERM-898) is a drug that was formerly marketed in France but is now no longer sold.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA80|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=80–}}{{cite book|author=William Andrew Publishing| chapter = Amixetrine Hydrochloride |title=Pharmaceutical Manufacturing Encyclopedia | edition = 3rd| chapter-url=https://books.google.com/books?id=_J2ti4EkYpkC&pg=PA285|date=22 October 2013|publisher=Elsevier|isbn=978-0-8155-1856-3|pages=285–}} According to various sources it has been said to be an anti-inflammatory, antidepressant, antispasmodic, anticholinergic, antihistamine, and antiserotonergic, but its definitive indications and pharmacology are unclear. The drug was first synthesized in 1969 and was introduced in France in 1972.