:Anthanthrone

{{Chembox

| ImageFile = Anthanthrone.svg

| ImageSize =

| ImageAlt =

| PIN = Dibenzo[def,mno]chrysene-6,12-dione

| OtherNames = Anthanthrone orange

|Section1={{Chembox Identifiers

| CASNo = 641-13-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T93Y5J867C

| ChemSpiderID = 84997

| EC_number = 211-372-0

| PubChem = 94183

| StdInChI=1S/C22H10O2/c23-21-13-5-1-3-11-7-9-16-19(17(11)13)20-15(21)10-8-12-4-2-6-14(18(12)20)22(16)24/h1-10H

| StdInChIKey = PGEHNUUBUQTUJB-UHFFFAOYSA-N

| SMILES = C1=CC2=C3C(=C1)C(=O)C4=C5C3=C(C=C2)C(=O)C6=CC=CC(=C65)C=C4

}}

|Section2={{Chembox Properties

| C=22|H=10|O=2

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Anthanthrone is a synthetic anthraquinone. Its derivative 4,10-dibromoanthanthrone (Pigment Red 168) is a component of some industrial paints. It is prepared from naphthostyril.{{Ullmann|first1=K.|last1=Hunger|first2=W.|last2=Herbst|title=Pigments, Organic|year=2012|doi=10.1002/14356007.a20_371}}{{cite journal|doi=10.1107/S0567740871003303|title=The crystal structure of anthanthrone|year=1971|last1=Edwards|first1=I. A. S.|last2=Stadler|first2=H. P.|journal=Acta Crystallographica Section B: Structural Crystallography and Crystal Chemistry|volume=27|issue=5|pages=946–952|doi-access=|bibcode=1971AcCrB..27..946E }}