:Astringin
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477369056
| Name = Astringin
| ImageFile = Astringin.svg
| ImageSize = 300px
| ImageName = Chemical structure of astringin
| ImageAlt = Chemical structure of astringin
| IUPACName = 3-[(E)-2-(2,3-Dihydroxyphenyl)ethen-1-yl]-5-hydroxyphenyl β-D-glucopyranoside
| SystematicName = (2S,3R,4S,5S,6R)-2-{3-[(E)-2-(3,4-Dihydroxyphenyl)ethen-1-yl]-5-hydroxyphenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 29884-49-9
| CASNo_Ref = {{cascite|changed|??}}
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4ER6YKM4YL
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 358769
| PubChem = 5281712
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445028
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 2899
| SMILES = O(c2cc(O)cc(\C=C\c1ccc(O)c(O)c1)c2)[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO
| InChI = 1/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-13-6-11(5-12(22)8-13)2-1-10-3-4-14(23)15(24)7-10/h1-8,16-27H,9H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1
| InChIKey = PERPNFLGJXUDDW-CUYWLFDKBH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-13-6-11(5-12(22)8-13)2-1-10-3-4-14(23)15(24)7-10/h1-8,16-27H,9H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PERPNFLGJXUDDW-CUYWLFDKSA-N
| MeSHName =
}}
|Section2={{Chembox Properties
| C=20 | H=22 | O=9
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Astringin is a stilbenoid, the 3-β-D-glucoside of piceatannol.{{PubChem|5281712}} It can be found in the bark of Picea sitchensis{{cite journal | doi = 10.1016/S0031-9422(00)88881-0| title = Stilbene glucosides in the bark of Picea sitchensis| date = 1976| last1 = Aritomi| first1 = Masakazu| last2 = Donnelly| first2 = Dervilla M.X.| journal = Phytochemistry| volume = 15| issue = 12| pages = 2006–2008| bibcode = 1976PChem..15.2006A}}{{cite journal | doi = 10.1016/0031-9422(91)83610-W| title = Astringin and isorhapontin distribution in Sitka spruce trees| date = 1991| last1 = Toscano Underwood| first1 = Claudia D.| last2 = Pearce| first2 = Raymond B.| journal = Phytochemistry| volume = 30| issue = 7| pages = 2183–2189| bibcode = 1991PChem..30.2183T}} and Picea abies (Norway spruce).{{cite journal | doi = 10.1111/j.1439-0329.1992.tb01436.x| title = Stilbenes and resin acids in relation to the penetration of Heterobasidion annosum through the bark of Picea abies| date = 1992| last1 = Lindberg| first1 = M.| last2 = Lundgren| first2 = L.| last3 = Gref| first3 = R.| last4 = Johansson| first4 = M.| journal = European Journal of Forest Pathology| volume = 22| issue = 2| pages = 95–106}}
It is also present in Vitis vinifera cells cultures{{cite journal | pmid = 9191572 | url = http://www.clinchem.org/content/43/6/1092.full.pdf+html | date = 1997 | last1 = Mérillon | first1 = J. M. | last2 = Fauconneau | first2 = B. | last3 = Teguo | first3 = P. W. | last4 = Barrier | first4 = L. | last5 = Vercauteren | first5 = J. | last6 = Huguet | first6 = F. | title = Antioxidant activity of the stilbene astringin, newly extracted from Vitis vinifera cell cultures | journal = Clinical Chemistry | volume = 43 | issue = 6 Pt 1 | pages = 1092–1093 | doi = 10.1093/clinchem/43.6.1092 }} and in wine.{{cite journal |last1=Vitrac |first1=Xavier |last2=Bornet |first2=Aurélie |last3=Vanderlinde |first3=Regina |last4=Valls |first4=Josep |last5=Richard |first5=Tristan |last6=Delaunay |first6=Jean-Claude |last7=Mérillon |first7=Jean-Michel |last8=Teissédre |first8=Pierre-Louis |title=Determination of Stilbenes (δ-viniferin, trans-astringin, trans-piceid, cis- and trans-resveratrol, ε-viniferin) in Brazilian Wines |journal=Journal of Agricultural and Food Chemistry |volume=53 |issue=14 |pages=5664–9 |year=2005 |pmid=15998130 |doi=10.1021/jf050122g}}