:Atizoram
{{Chembox
| ImageFile = Atizoram structure.svg
| ImageSize = 200px
| IUPACName = 5-
| OtherNames = CP-80633
| Section1 = {{Chembox Identifiers
| CASNo = 135637-46-6
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O84FJB49WI
| PubChem = 9861730
| ChEMBL = 1229569
| ChemSpiderID = 8037426
| SMILES = COC1=C(C=C(C=C1)C2CNC(=O)NC2)O[C@H]3C[C@@H]4CC[C@H]3C4
| StdInChI = 1S/C18H24N2O3/c1-22-15-5-4-12(14-9-19-18(21)20-10-14)8-17(15)23-16-7-11-2-3-13(16)6-11/h4-5,8,11,13-14,16H,2-3,6-7,9-10H2,1H3,(H2,19,20,21)/t11-,13+,16+/m1/s1
| StdInChIKey = LITNEAPWQHVPOK-FFSVYQOJSA-N
}}
| Section2 = {{Chembox Properties
| C=18 | H=24 | N=2 | O=3
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Atizoram (CP-80633) is a phosphodiesterase 4 inhibitor.{{cite journal | pmid= 9360015 | title = Differential in vivo and in vitro bronchorelaxant activities of CP-80,633, a selective phosphodiesterase 4 inhibitor | volume=75 | issue=8 | date=August 1997 | journal=Can. J. Physiol. Pharmacol. | pages=1001–8| last1 = Wright | first1 = K. F. | last2 = Turner | first2 = C. R. | last3 = Jayasinghe-Beck | first3 = R. | last4 = Cohen | first4 = V. L. | last5 = Cheng | first5 = J. B. | last6 = Watson | first6 = J. W. | doi = 10.1139/y97-123 }}