:Azalein

{{chembox

| Watchedfields = changed

| verifiedrevid = 462567245

| Name = Azalein

| ImageFile = Azalein.svg

| ImageSize = 300px

| ImageName = Azalein structure

| IUPACName = 3′,4′,5-Trihydroxy-7-methoxy-3-(α-L-rhamnopyranosyloxy)flavone

| SystematicName = 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}-4H-1-benzopyran-4-one

| OtherNames = Azaleatin 3-O-α-L-rhamnoside

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 29028-02-2

| PubChem = 5321320

| SMILES = CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)OC)O)C4=CC(=C(C=C4)O)O)O)O)O

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 26286942

| InChI = 1/C22H22O11/c1-8-16(26)18(28)19(29)22(31-8)33-21-17(27)15-13(30-2)6-10(23)7-14(15)32-20(21)9-3-4-11(24)12(25)5-9/h3-8,16,18-19,22-26,28-29H,1-2H3/t8-,16-,18+,19+,22-/m0/s1

| InChIKey = FYSMTINDJSASRR-UFGFRKJLBS

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H22O11/c1-8-16(26)18(28)19(29)22(31-8)33-21-17(27)15-13(30-2)6-10(23)7-14(15)32-20(21)9-3-4-11(24)12(25)5-9/h3-8,16,18-19,22-26,28-29H,1-2H3/t8-,16-,18+,19+,22-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FYSMTINDJSASRR-UFGFRKJLSA-N

}}

|Section2={{Chembox Properties

| C=22|H=22|O=11

| Density = 1.683 g/mL

| MeltingPtC = 181 to 185

| MeltingPt_notes =

| BoilingPt =

}}

}}

Azalein is a chemical compound. It is a flavonol, a type of flavonoid. It is the 3-O-α-L-rhamnoside of azaleatin. It can be found in the flowers of Plumbago and Rhododendron species.{{cite journal| pmid=13904580 | volume=96 | title=Plant polyphenols. 5. Occurrence of azalein and related pigments in flowers of Plumbago and Rhododendron species | date=January 1962 | journal=Arch. Biochem. Biophys. | pages=171–8 | last1 = Harborne | first1 = JB | doi=10.1016/0003-9861(62)90467-8}}