:BD-1047
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 461748395
| IUPAC_name = N'-[2-(3,4-dichlorophenyl)ethyl]-N,N,N'-trimethylethane-1,2-diamine
| image = BD-1047 Structure.svg
| width = 200
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 6680
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 138356-20-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1S3X75QGDO
| ATC_prefix = none
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 143360
| PubChem = 188914
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 164154
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H20Cl2N2/c1-16(2)8-9-17(3)7-6-11-4-5-12(14)13(15)10-11/h4-5,10H,6-9H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MGVRNMUKTZOQOW-UHFFFAOYSA-N
| C=13 | H=20 | Cl=2 | N=2
| smiles = Clc1ccc(CCN(C)CCN(C)C)cc1Cl
| melting_point =
| melting_high =
}}
BD-1047 is a sigma receptor antagonist, selective for the σ1 subtype. It has effects in animal studies suggestive of antipsychotic activity and may also be useful in the treatment of neuropathic pain.{{cite journal |vauthors=Skuza G, Rogóz Z |title=Effect of BD 1047, a sigma1 receptor antagonist, in the animal models predictive of antipsychotic activity |journal=Pharmacological Reports |volume=58 |issue=5 |pages=626–35 |year=2006 |pmid=17085854 }}{{cite journal |vauthors=Roh DH, Kim HW, Yoon SY, Seo HS, Kwon YB, Kim KW, Han HJ, Beitz AJ, Na HS, Lee JH |title=Intrathecal injection of the sigma(1) receptor antagonist BD1047 blocks both mechanical allodynia and increases in spinal NR1 expression during the induction phase of rodent neuropathic pain |journal=Anesthesiology |volume=109 |issue=5 |pages=879–89 |date=November 2008|pmid=18946301 |doi=10.1097/ALN.0b013e3181895a83 |doi-access=free }}
More recent studies also suggest a novel role for BD-1047 in attenuating ethanol-induced neurotoxicity in vitro, and additional research is being conducted on this compound as a possible pharmacotherapy for alcohol use disorder (AUD) {{cite journal |vauthors=Reynolds AR, Saunders MA, Prendergast MA |title=Ethanol Stimulates Endoplasmic Reticulum Inositol Triphosphate and Sigma Receptors to Promote Withdrawal-Associated Loss of Neuron-Specific Nuclear Protein/Fox-3. |journal=Alcohol Clin Exp Res |volume=40 |issue=7 |pages=1454–61 |year=2016 |pmid=27177604 |doi= 10.1111/acer.13097|pmc=6662182 }}