:Batanopride

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461752878

| IUPAC_name = 4-amino-5-chloro-N-(2-diethylaminoethyl)-2-(3-oxobutan-2-yloxy)benzamide

| image = Batanopride.png

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 102670-46-2

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 38594

| PubChem = 59692

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1AT99K728N

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 53849

| smiles = Clc1cc(c(OC(C(=O)C)C)cc1N)C(=O)NCCN(CC)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H26ClN3O3/c1-5-21(6-2)8-7-20-17(23)13-9-14(18)15(19)10-16(13)24-12(4)11(3)22/h9-10,12H,5-8,19H2,1-4H3,(H,20,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZYOJXUNLLOBURP-UHFFFAOYSA-N

| C=17 | H=26 | Cl=1 | N=3 | O=3

}}

Batanopride (BMY-25,801) is an antiemetic drug of the benzamide class which acts as a selective 5-HT₃ receptor antagonist.{{cite journal | vauthors = Gylys JA, Wright RN, Nicolosi WD, Buyniski JP, Crenshaw RR | title = BMY-25801, an antiemetic agent free of D2-dopamine receptor antagonist properties | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 244 | issue = 3 | pages = 830–7 | date = March 1988 | pmid = 2978041 }} It was trialled to reduce nausea during cancer chemotherapy, but was never approved for medical use due to dose-limiting side effects including hypotension and long QT syndrome.{{cite journal | vauthors = Fleming GF, Vokes EE, McEvilly JM, Janisch L, Francher D, Smaldone L | title = Double-blind, randomized crossover study of metoclopramide and batanopride for prevention of cisplatin-induced emesis | journal = Cancer Chemotherapy and Pharmacology | year = 1991 | volume = 28 | issue = 3 | pages = 226–7 | pmid = 1855280 | doi = 10.1007/bf00685516 | s2cid = 22520773 }}