:Batoprazine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 459590863
| IUPAC_name = 8-(piperazin-1-yl)-2H-chromen-2-one
| image = Batoprazine-ifa.png
| tradename =
| legal_status = Uncontrolled
| routes_of_administration = Oral
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 105685-11-8
| ATC_prefix = none
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H14N2O2/c16-12-5-4-10-2-1-3-11(13(10)17-12)15-8-6-14-7-9-15/h1-5,14H,6-9H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MTYYDFXUUJQQRS-UHFFFAOYSA-N
| PubChem = 184839
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2104650
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 160706
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = EZY3PL8Q0M
| synonyms = 8-(1-piperazinyl)coumarin;
8-(1-piperazinyl)-2H-
| C=13 | H=14 | N=2 | O=2
| smiles = O=C/2Oc1c(cccc1\C=C\2)N3CCNCC3
}}
Batoprazine is a drug of the phenylpiperazine class which has been described as a serenic or antiaggressive agent.{{cite journal | author = Olivier B | title = Serotonin and aggression | journal = Annals of the New York Academy of Sciences | volume = 1036 | pages = 382–92 |date=December 2004 | pmid = 15817750 | doi = 10.1196/annals.1330.022 | s2cid = 45595253 }}{{cite journal |vauthors=Olivier B, van Oorschot R | title = 5-HT1B receptors and aggression: a review | journal = European Journal of Pharmacology | volume = 526 | issue = 1–3 | pages = 207–17 |date=December 2005 | pmid = 16310769 | doi = 10.1016/j.ejphar.2005.09.066 }} It acts as a 5-HT1A and 5-HT1B receptor agonist.{{cite journal |vauthors=Gommans J, Hijzen TH, Maes RA, Olivier B | title = Discriminative stimulus properties of eltoprazine | journal = Life Sciences | volume = 61 | issue = 1 | pages = 11–9 | year = 1997 | pmid = 9200664 | doi = 10.1016/S0024-3205(97)00352-4}} It is closely related to eltoprazine, fluprazine, and naphthylpiperazine, of which possess similar actions and effects.