:Benzazocine
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 459869429
| ImageFile = Benzazocine.png
| ImageSize = 100px
| ImageFileL2 = 3-Benzazocine-3D-balls-by-AHRLS-2012.png
| ImageSizeL2 = 100px
| ImageFileR2 = 3-Benzazocine-3D-vdW-by-AHRLS-2012.png
| ImageSizeR2 = 100px
| PIN = (1Z,3Z,5Z)-3-Benzazocine
| OtherNames = Benzoazocine
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 265-50-9
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H9N/c1-2-5-11-7-9-12-8-3-6-10(11)4-1/h1-9H/b6-3-,8-3-,9-7-,10-6-,11-7-,12-8-,12-9-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DMGLUDJTJZXMMG-SLVRTNKRSA-N
| PubChem = 23636835
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 14453507
| SMILES = c1cccc2\C=C/N=C\C=C/c12
| InChI = InChI=1S/C11H9N/c1-2-5-11-7-9-12-8-3-6-10(11)4-1/h1-9H/b6-3-,8-3-,9-7-,10-6-,11-7-,12-8-,12-9-
}}
|Section2={{Chembox Properties
| Formula = C11H9N
| MolarMass = 155.20 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Benzazocine, also known as benzoazocine, is a chemical compound. It consists of a benzene ring bound to an azocine ring. A related compound is benzomorphan.