:Benzilic acid

{{distinguish|benzyl alcohol}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443415569

| ImageFile = Benzilsäure.svg

| ImageSize = 180

| ImageAlt = Skeletal formula of benzilic acid

| ImageFile1 = Benzilic-acid-3D-balls.png

| ImageAlt1 = Ball-and-stick model of the benzilic acid molecule

| PIN= Hydroxydi(phenyl)acetic acid{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = The Royal Society of Chemistry | date = 2014 | location = Cambridge | page = 748 | doi = 10.1039/9781849733069-FP001 | isbn = 978-0-85404-182-4| chapter = Front Matter }}

| OtherNames = α,α-Diphenyl-α-hydroxyacetic acid, α,α-Diphenylglycolic acid, α-Hydroxydiphenyl acetic acid, 2,2-Diphenyl-2-hydroxyacetic acid, 2-Hydroxy-2,2-diphenylacetic acid, Diphenyl glycolic acid, Hydroxydiphenyl acetic acid

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6220

| InChI = 1/C14H12O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,17H,(H,15,16)

| InChIKey = UKXSKSHDVLQNKG-UHFFFAOYAV

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 578171

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H12O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,17H,(H,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UKXSKSHDVLQNKG-UHFFFAOYSA-N

| CASNo = 76-93-7

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 6463

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 39414

| Gmelin = 281752

| Beilstein = 521402

| EINECS = 200-993-2

| UNII = 8F6J993XXR

| SMILES = O=C(O)C(O)(c1ccccc1)c2ccccc2

}}

|Section2={{Chembox Properties

| C=14 | H=12 | O=3

| Appearance = white solid

| Density = 1.08 g/cm³

| MeltingPtC = 150 to 152

| MeltingPt_notes =

| BoilingPtC = 180

| BoilingPt_notes = (17.3 hPa)

| Solubility = 2 g/L (20 °C)

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| NFPA-H = 2

| NFPA-F = 1

| NFPA-R = 0

| NFPA-S =

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302}}

| PPhrases = {{P-phrases|264|270|301+312|330|501}}

}}

}}

Benzilic acid is an organic compound with formula {{chem|C|14|H|12|O|3}} or ({{chem|C|6|H|5}})₂(HO)C(COOH). It is a white crystalline aromatic acid, soluble in many primary alcohols.