:Berkelic acid
{{Chembox
| ImageFile = Berkelic acid.svg
| ImageSize = 150px
| ImageAlt =
| IUPACName =
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 905305-61-5
| PubChem = 54612784
| ChemSpiderID = 28286696
| SMILES = CCCCC[C@@H]1Cc2cc(c(c3c2[C@@H](O1)C[C@]4(O3)[C@H]([C@@H](CO4)CC(=O)[C@](C)(CC)C(=O)OC)C)C(=O)O)O
| InChI = 1/C29H40O9/c1-6-8-9-10-19-11-17-12-20(30)24(26(32)33)25-23(17)21(37-19)14-29(38-25)16(3)18(15-36-29)13-22(31)28(4,7-2)27(34)35-5/h12,16,18-19,21,30H,6-11,13-15H2,1-5H3,(H,32,33)/t16-,18+,19+,21-,28-,29-/m0/s1
| InChIKey = KUPCHRRTAPZASB-FZIMWOAEBA
| StdInChI = 1S/C29H40O9/c1-6-8-9-10-19-11-17-12-20(30)24(26(32)33)25-23(17)21(37-19)14-29(38-25)16(3)18(15-36-29)13-22(31)28(4,7-2)27(34)35-5/h12,16,18-19,21,30H,6-11,13-15H2,1-5H3,(H,32,33)/t16-,18+,19+,21-,28-,29-/m0/s1
| StdInChIKey = KUPCHRRTAPZASB-FZIMWOAESA-N }}
|Section2={{Chembox Properties
| C = 29 | H = 40 | O = 9
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Berkelic acid is a fungal isolate with anticancer activity in vitro.{{cite journal|pmid=16808526|year=2006|last1=Stierle|first1=AA|last2=Stierle|first2=DB|last3=Kelly|first3=K|title=Berkelic acid, a novel spiroketal with selective anticancer activity from an acid mine waste fungal extremophile|volume=71|issue=14|pages=5357–60|doi=10.1021/jo060018d|journal=The Journal of Organic Chemistry}} It was first discovered in a fungal species which evolved to live in the Berkeley Pit.