:Bifuhalol

{{Chembox

| ImageFile = Bifuhalol.svg

| ImageSize = 250px

| ImageAlt = Chemical structure of bifuhalol

| PIN = 5-(2,4,6-Trihydroxyphenoxy)benzene-1,2,3-triol

| OtherNames = 5-(2,4,6-Trihydroxyphenoxy)-1,2,3-benzenetriol

|Section1={{Chembox Identifiers

| CASNo = 53254-99-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2CYH3FN39A

| ChemSpiderID = 278565

| InChI = 1S/C12H10O7/c13-5-1-9(16)12(10(17)2-5)19-6-3-7(14)11(18)8(15)4-6/h1-4,13-18H

| InChIKey = PYUFXOMNRPZYTI-UHFFFAOYSA-N

| PubChem = 314874

| SMILES = C1=C(C=C(C(=C1O)OC2=CC(=C(C(=C2)O)O)O)O)O

}}

|Section2={{Chembox Properties

| C=12 | H=10 | O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Bifuhalol is a phlorotannin. The ethanol extract of the brown alga Sargassum ringgoldianum contains phlorotannins of the bifuhalol type, which shows an antioxidative activity.{{cite journal | doi = 10.1007/s10126-005-6168-9 | title = Phlorotannins as Radical Scavengers from the Extract of Sargassum ringgoldianum | date = 2006 | last1 = Nakai | first1 = Masaaki | last2 = Kageyama | first2 = Norihiko | last3 = Nakahara | first3 = Koichi | last4 = Miki | first4 = Wataru | journal = Marine Biotechnology | volume = 8 | issue = 4 | pages = 409–414 | pmid = 16602026 | bibcode = 2006MarBt...8..409N | s2cid = 29097842 }}