:Bis(2,4-dinitrophenyl) oxalate
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 435495369
| ImageFile = Bis(2,4-dinitrophenyl) oxalate.png
| ImageSize = 250
| ImageAlt = Skeletal formula of DNPO
| ImageFile1 = Bis(2,4-dinitrophenyl) oxalate 3D ball.png
| ImageSize1 = 250
| ImageAlt1 = Ball-and-stick model of the DNPO molecule
| PIN = Bis(2,4-dinitrophenyl) oxalate
| OtherNames = Oxalic acid bis(2,4-dinitrophenyl) ester
|Section1={{Chembox Identifiers
| Abbreviations = DNPO
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 16536-30-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = A4Q7NQ4ENT
| SMILES = O=C(Oc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O)C(=O)Oc2ccc([N+]([O-])=O)cc2[N+]([O-])=O
| PubChem = 3080704
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2338445
| InChI = 1/C14H6N4O12/c19-13(29-11-3-1-7(15(21)22)5-9(11)17(25)26)14(20)30-12-4-2-8(16(23)24)6-10(12)18(27)28/h1-6H
| InChIKey = CBZOGAWUNMFXFQ-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C14H6N4O12/c19-13(29-11-3-1-7(15(21)22)5-9(11)17(25)26)14(20)30-12-4-2-8(16(23)24)6-10(12)18(27)28/h1-6H
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CBZOGAWUNMFXFQ-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=14 | H=6 | N=4 | O=12
| Appearance = White crystalline powder
| Density = 1.759 g/cm3
| MeltingPt =
| BoilingPtC =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPtC =
| AutoignitionPtC = }}
}}
Bis(2,4-dinitrophenyl) oxalate (DNPO) is a source of 1,2-dioxetanedione, a chemical used in glow sticks.{{Cite web | url = http://www.chm.bris.ac.uk/motm/dnpo/VV_exp_26.htm | title = DNPO - a Chemiluminescent Rainbow Other | publisher = University of Leeds}} Other chemicals related to DNPO used in glow sticks include bis(2,4,6-trichlorophenyl)oxalate (TCPO) and bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate (CPPO).