:Bis(2-Hydroxyethyl) terephthalate

{{Chembox

| ImageFile = Bis(2-hydroxyethyl) terephthalate.svg

| ImageSize =

| PIN = Bis(2-hydroxyethyl) benzene-1,4-dicarboxylate{{BlueBook2013|rec=65.1.1.2.1}}

| OtherNames = Bis(2-hydroxyethyl) terephthalate

|Section1={{Chembox Identifiers

| CASNo = 959-26-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J61IL5R964

| PubChem = 13739

| ChemSpiderID = 13144

| SMILES = O=C(OCCO)c1ccc(C(=O)OCCO)cc1

| InChI = 1/C12H14O6/c13-5-7-17-11(15)9-1-2-10(4-3-9)12(16)18-8-6-14/h1-4,13-14H,5-8H2

| InChIKey = QPKOBORKPHRBPS-UHFFFAOYAN

| StdInChI = 1S/C12H14O6/c13-5-7-17-11(15)9-1-2-10(4-3-9)12(16)18-8-6-14/h1-4,13-14H,5-8H2

| StdInChIKey = QPKOBORKPHRBPS-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=12 | H=14 | O=6

| Appearance = White powder

| Density = 1.3 (±0.1) g/cm³

| MeltingPt = 106 °C

| BoilingPt =

| Solubility = 0.593 g/L{{Cite journal |last=Yuan |first=Peiquan |last2=Liu |first2=Baoshu |last3=Li |first3=Qiuju |last4=Sun |first4=Hua |date=2022 |title=Solubility Determination and Correlation for Bis(2-hydroxyethyl) Terephthalate (BHET) in Four Binary Solvents from 283.15 to 323.15 K |journal=Journal of Chemical & Engineering Data |language=en |volume=67 |issue=9 |pages=2693–2705 |doi=10.1021/acs.jced.2c00194}}

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt = 172.0 (±19.4) °C

| AutoignitionPt =

}}

}}

Bis(2-Hydroxyethyl) terephthalate (BHET) is an organic compound; it is the ester of ethylene glycol and terephthalic acid. Together with 2-hydroxyethyl terephthalic acid, bis(2-Hydroxyethyl) terephthalate is an intermediate in the production of poly(ethylene terephthalate).

It is the product of the glycolysis reaction of PET with Ethylene glycol.{{Cite web |title=Polyethylene terephthalate is an often-recycled plastic, but industry is still seeking major improvements |url=https://cen.acs.org/environment/recycling/recyclers-break-polyester-barrier/101/i39?ref=search_results |access-date=2025-03-15 |website=Chemical & Engineering News |language=en}}