:Botryodiplodin

{{Chembox

| ImageFile = Botryodiplodin Structure.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName = 1-((3S,4S)-5-Hydroxy-4-methyloxolan-3-yl)ethanone

| OtherNames = (-)-Botryodiplodin

|Section1={{Chembox Identifiers

| CASNo = 27098-03-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5G35Q22R8M

| ChEMBL = 2007203

| ChEBI = 168857

| ChemSpiderID = 9427105

| PubChem = 11252078

| SMILES = C(C)(=O)[C@H]1[C@@H](C)C(O)OC1

| StdInChI=1S/C7H12O3/c1-4-6(5(2)8)3-10-7(4)9/h4,6-7,9H,3H2,1-2H3/t4-,6-,7?/m1/s1

| StdInChIKey = CLYSZQBIUYRLNX-WETFRILZSA-N

}}

|Section2={{Chembox Properties

| C=7 | H=12 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Botryodiplodin is an antibiotic mycotoxin produced by Penicillium.{{cite journal | pmid = 17628075 | year = 2007 | last1 = Cabedo | first1 = N | last2 = López-Gresa | first2 = MP | last3 = Primo | first3 = J | last4 = Ciavatta | first4 = ML | last5 = González-Mas | first5 = MC | title = Isolation and structural elucidation of eight new related analogues of the mycotoxin (−)-botryodiplodin from Penicillium coalescens | volume = 55 | issue = 17 | pages = 6977–83 | doi = 10.1021/jf071568v | journal = Journal of Agricultural and Food Chemistry| bibcode = 2007JAFC...55.6977C | hdl = 10251/99756 | hdl-access = free }}