:Bromopropylate

{{Chembox

| ImageFile = Bromopropylate.svg

| ImageSize = 200px

| ImageFile2 = Vial of Brompropylat.jpg

| ImageSize2 = 150px

| PIN = Propan-2-yl bis(4-bromophenyl)hydroxyacetate

| OtherNames = Acarol; Isopropyl 4,4'-dibromobenzilate; Phenisobromolate

|Section1={{Chembox Identifiers

| CASNo = 18181-80-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3U468ZM257

| PubChem = 28936

| ChemSpiderID = 26916

| SMILES = Brc1ccc(cc1)C(O)(c2ccc(Br)cc2)C(=O)OC(C)C

| InChI = 1/C17H16Br2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3

| InChIKey = FOANIXZHAMJWOI-UHFFFAOYAR

| StdInChI = 1S/C17H16Br2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3

| StdInChIKey = FOANIXZHAMJWOI-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=17 | H=16 | Br=2 | O=3

| Appearance = White solid{{GESTIS|ZVG=490598}}

| Density = 1.59 g/cm³ (20 °C)

| MeltingPtC = 77

| MeltingPt_ref =

| BoilingPt =

| Solubility = 0.1 mg/L (20 °C)

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Bromopropylate is a chemical compound used as an acaricide against spider mites in apiaries and on fruit crops such as citrus and grapes. It was banned by the European Union in 2011.