:Burkinabin C

{{chembox

| verifiedrevid = 462759043

| Name = Burkinabin C

| ImageFile = Burkinabin C.svg

| ImageSize = 200px

| ImageName = Chemical structure of burkinabin C

| ImageAlt = Chemical structure of burkinabin C

| PIN = (1S,3R,4R,5R)-1,3-Dihydroxy-4,5-bis[(4-hydroxy-3-methoxybenzoyl)oxy]cyclohexane-1-carboxylic acid

| OtherNames = 4,5-O-divanilloylquinic acid

|Section1={{Chembox Identifiers

| CASNo = 720682-39-3

| CASNo_Ref = {{cascite|correct|??}}

| PubChem = 23250814

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10363137

| SMILES = O=C(O[C@@H]2[C@H](O)C[C@](O)(C[C@H]2OC(=O)c1ccc(O)c(OC)c1)C(O)=O)c3ccc(O)c(OC)c3

| InChI = 1/C23H24O12/c1-32-16-7-11(3-5-13(16)24)20(27)34-18-10-23(31,22(29)30)9-15(26)19(18)35-21(28)12-4-6-14(25)17(8-12)33-2/h3-8,15,18-19,24-26,31H,9-10H2,1-2H3,(H,29,30)/t15-,18-,19-,23+/m1/s1

| InChIKey = NNIPMYIDMKBMBF-ALIIGJLFBH

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H24O12/c1-32-16-7-11(3-5-13(16)24)20(27)34-18-10-23(31,22(29)30)9-15(26)19(18)35-21(28)12-4-6-14(25)17(8-12)33-2/h3-8,15,18-19,24-26,31H,9-10H2,1-2H3,(H,29,30)/t15-,18-,19-,23+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NNIPMYIDMKBMBF-ALIIGJLFSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=23 | H=24 | O=12

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Burkinabin C is a divanilloylquinic acid found in the root bark of Fagara zanthoxyloides (Zanthoxylum zanthoxyloides).{{cite journal | doi = 10.1016/j.phytochem.2004.02.025 | title = LC/MS/NMR analysis of isomeric divanilloylquinic acids from the root bark of Fagara zanthoxyloides Lam | date = 2004 | last1 = Ouattara | first1 = B. | last2 = Angenot | first2 = L. | last3 = Guissou | first3 = P. | last4 = Fondu | first4 = P. | last5 = Dubois | first5 = J. | last6 = Frédérich | first6 = M. | last7 = Jansen | first7 = O. | last8 = Van Heugen | first8 = J. C. | last9 = Wauters | first9 = J. N. | last10 = Tits | first10 = M. | journal = Phytochemistry | volume = 65 | issue = 8 | pages = 1145–1151 | pmid = 15110696 | bibcode = 2004PChem..65.1145O }}{{cite journal|title=Traditional Herbal Management of Sickle Cell Anemia: Lessons from Nigeria |journal=Anemia |volume=2012 |pages=1–9 |doi=10.1155/2012/607436 |pmid=23198140|pmc=3502758 |year=2012 |last1=Ameh |first1=Sunday J |last2=Tarfa |first2=Florence D |last3=Ebeshi |first3=Benjamin U |doi-access=free}}