:CAR-301,060
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 379637583
| IUPAC_name = [(7R,8R)-7-methyl-1-azabicyclo[2.2.2]octan-8-yl]2-cyclopentyl-2-hydroxy-2-phenylacetate
| image = CAR-301,060_structure.png
| width = 240
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 153601-03-7
| ATC_prefix =
| ATC_suffix =
| PubChem = 44149220
| DrugBank =
| ChemSpiderID = 65323097
| C=21 | H=29 | N=1 | O=3
| smiles = C[C@@H]1[C@@H](C2CCN1CC2)OC(=O)C(C3CCCC3)(C4=CC=CC=C4)O
| StdInChI=1S/C21H29NO3/c1-15-19(16-11-13-22(15)14-12-16)25-20(23)21(24,18-9-5-6-10-18)17-7-3-2-4-8-17/h2-4,7-8,15-16,18-19,24H,5-6,9-14H2,1H3/t15-,19+,21?/m1/s1
| StdInChIKey=ICYFZPARHUFDKQ-GAKLZJQJSA-N
}}
CAR-301,060 (also known as cis-2-Methyl-3-quinuclidinylphenylcyclopentylglycolate or just by its code number 301060) is a potent and long lasting anticholinergic deliriant drug, related to the chemical warfare agent 3-Quinuclidinyl benzilate (QNB). It was developed under contract to Edgewood Arsenal, Fort Detrick,Maryland during the 1960s as part of the US military chemical weapons program, during research to improve upon the properties of earlier agents such as QNB.
CAR-301,060 was found to be slightly less potent than QNB, and with around the same duration of action, but with a very high central to peripheral effects ratio.{{cite book |author1=National Research Council (US) Panel on Anticholinesterase Chemicals |url=http://www.nap.edu/openbook.php?record_id=740&page=199 |title=Possible Long-Term Health Effects of Short-Term Exposure to Chemical Agents |author2=National Research Council (US) Panel on Anticholinergic Chemicals |date=1982 |publisher=The National Academies Press |isbn=978-0-309-07759-0 |volume=1 |pages=199–200 |doi=10.17226/740 |pmid=25032448}}{{cite book | vauthors = Ketchum JS | title = Chemical Warfare Secrets Almost Forgotten. A Personal Story of Medical Testing of Army Volunteers with Incapacitating Chemical Agents During the Cold War. | publisher = ChemBooks Inc | date = 2006 | isbn = 978-1-4243-0080-8 }}
See also
References
{{Reflist}}
{{Hallucinogens}}
{{Muscarinic acetylcholine receptor modulators}}
Category:Muscarinic antagonists
Category:Incapacitating agents
Category:Phenylcyclopentylglycolate esters
{{hallucinogen-stub}}
Fort D